
CAS Number87314-49-6
Synonyms1,4-dichlorobenzene-5,6-dithiol; 1,2-Benzenedithiol,3,6-dichloro; MFCD00216665; 3,6-dichloro-benzene-1,2-dithiol; H2(Cl2-bdt); 3,6-Dichloro-1,2-benzenedithiol; 3,6-dichloro-1,2-benzenedithiole
Molecular FormulaC6H4Cl2S2
Molecular Weight211.13200
Density1.523g/cm3
Boiling Point314.9ºC at 760 mmHg
Melting Point58-60ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 87314-49-6 |
| Catalog No. | 2A-1169294 |
| Chinese Name | 3,6-二氯-1,2-苯二硫醇 |
| Synonyms | 1,4-dichlorobenzene-5,6-dithiol; 1,2-Benzenedithiol,3,6-dichloro; MFCD00216665; 3,6-dichloro-benzene-1,2-dithiol; H2(Cl2-bdt); 3,6-Dichloro-1,2-benzenedithiol; 3,6-dichloro-1,2-benzenedithiole |
| Molecular Formula | C6H4Cl2S2 |
| Molecular Weight | 211.13200 |
| Density | 1.523g/cm3 |
| Boiling Point | 314.9ºC at 760 mmHg |
| Melting Point | 58-60ºC |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2930909090 |
| PubChem ID | 6692960 |
| SMILES | Sc1c(Cl)ccc(Cl)c1S |
| InChI | InChI=1S/C6H4Cl2S2/c7-3-1-2-4(8)6(10)5(3)9/h1-2,9-10H |
| InChI Key | AJCUDWCLDWDLNY-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2930909090. other organo-sulfur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 8-AMINO-1-OCTANOL | 19008-71-0 | 2A-1169277 |
| QUINACRINE DIHYDROCHLORIDE | 69-05-6 | 2A-1169280 |
| 3-(ETHOXYMETHYLENE)-2,4-PENTANEDIONE | 33884-41-2 | 2A-1169290 |
| 4-(2-FLUOROPHENYL)BUTANOIC ACID | 143654-62-0 | 2A-1169292 |
| 3-chloro-4-nitrophenol | 491-11-2 | 2A-1169293 |
| 1-(2-FLUOROPHENYL)-2-NITROPROPENE | 829-40-3 | 2A-1169300 |
| 4-(4-Bromophenyl)butan-1-ol | 75906-36-4 | 2A-1169303 |
| 2,3,4,6-TETRA-O-BENZYL-ALPHA-D-GALACTOPYRANOSE | 4291-69-4 | 2A-1169304 |
| N-Butyl-1-deoxygalactonojirimycin | 141206-42-0 | 2A-1169305 |
| 1-Deoxygalactonojirimycin | 108147-54-2 | 2A-1169306 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA