CAS Number68435-07-4
Synonymsmethyl 3-hydroxyadamantane-1-carboxylate; Methyl 3-hydroxy-1-adamantanecarboxylate; Tricyclo[3.3.1.1]decane-1-carboxylic acid, 3-hydroxy-, methyl ester
Molecular FormulaC12H18O3
Molecular Weight210.270
Density1.3±0.1 g/cm3
Boiling Point295.3±23.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 68435-07-4 |
| Catalog No. | 2A-1169072 |
| Chinese Name | 3-羟基-1-金刚烷羧酸甲酯 |
| Synonyms | methyl 3-hydroxyadamantane-1-carboxylate; Methyl 3-hydroxy-1-adamantanecarboxylate; Tricyclo[3.3.1.1]decane-1-carboxylic acid, 3-hydroxy-, methyl ester |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.270 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 295.3±23.0 °C at 760 mmHg |
| HTC | 2918199090 |
| PubChem ID | 6204604 |
| SMILES | COC(=O)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C12H18O3/c1-15-10(13)11-3-8-2-9(4-11)6-12(14,5-8)7-11/h8-9,14H,2-7H2,1H3 |
| InChI Key | BEBYNYCNFDDIFE-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(N,N-Dimethylaminomethyl)-5-methyl-2-hexanone | 91342-74-4 | 2A-1169066 |
| DECAFLUOROBUTANE | 355-25-9 | 2A-1169067 |
| N,N,N-TriMethyl-1-AdaMantyl AMMoniuM Hydroxide | 53075-09-5 | 2A-1169069 |
| AMantadine ForMate | 16790-64-0 | 2A-1169070 |
| (3-HYDROXY-ADAMANTAN-1-YL)-ACETIC ACID | 17768-36-4 | 2A-1169071 |
| adamantane-2,6-dione | 39751-07-0 | 2A-1169073 |
| 2-Isopropyl-2-adamantanol | 38432-77-8 | 2A-1169074 |
| Spinach, ext. | 90131-25-2 | 2A-1169077 |
| Parsley, ext. | 84012-33-9 | 2A-1169078 |
| HOMIDIUM CHLORIDE | 602-52-8 | 2A-1169081 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS