
CAS Number22647-95-6
Synonyms5-(4-bromophenyl)-2-thiophenecarbaldehyde; 5-(4-bromo-phenyl)-thiophene-2-carbaldehyde; 5-(p-Bromophenyl)thiophene-2-carboxaldehyde; 5-(4-Bromphenyl)-2-thiophencarboxaldehyd; 5-p-Bromphenylthiophen-2-aldehyd; 5-(p-Bromphenyl)-valeriansaeure; 5-(4-bromophenyl)-pentanoic acid; 2-Formyl-5-(4-bromophenyl)thiophene; 5-(4-bromophenyl)valeric acid
Molecular FormulaC11H13BrO2
Molecular Weight257.12400
Density1.408g/cm3
Boiling Point387.511ºC at 760 mmHg
AppearanceWhite to yellow solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 22647-95-6 |
| Catalog No. | 2A-1168821 |
| Chinese Name | 5-(4-溴苯基)戊酸 |
| Synonyms | 5-(4-bromophenyl)-2-thiophenecarbaldehyde; 5-(4-bromo-phenyl)-thiophene-2-carbaldehyde; 5-(p-Bromophenyl)thiophene-2-carboxaldehyde; 5-(4-Bromphenyl)-2-thiophencarboxaldehyd; 5-p-Bromphenylthiophen-2-aldehyd; 5-(p-Bromphenyl)-valeriansaeure; 5-(4-bromophenyl)-pentanoic acid; 2-Formyl-5-(4-bromophenyl)thiophene; 5-(4-bromophenyl)valeric acid |
| Molecular Formula | C11H13BrO2 |
| Molecular Weight | 257.12400 |
| Density | 1.408g/cm3 |
| Boiling Point | 387.511ºC at 760 mmHg |
| Appearance | White to yellow solid |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2916399090 |
| PubChem ID | 15840578 |
| SMILES | O=C(O)CCCCc1ccc(Br)cc1 |
| InChI | InChI=1S/C11H13BrO2/c12-10-7-5-9(6-8-10)3-1-2-4-11(13)14/h5-8H,1-4H2,(H,13,14) |
| InChI Key | YWILUDBFIBDCNN-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(3,4-dimethylbenzyl)propane-1,3-diol | 289902-88-1 | 2A-1168809 |
| diethyl 2-(3,4-dimethylbenzyl)malonate | 289902-87-0 | 2A-1168810 |
| 8-amino-5,7-dichloronaphthalen-2-ol | 497151-50-5 | 2A-1168811 |
| 1-tert-Butyl-4-isothiocyanatomethylbenzene | 31088-81-0 | 2A-1168812 |
| 3-(4-Methylphenyl)-6,7,8,9-tetrahydro-5H-benzocyclohepten-5-one | 229006-86-4 | 2A-1168820 |
| 5-(4-bromophenyl)-5-oxopentanoic acid methyl ester | 90991-23-4 | 2A-1168822 |
| 3-(3-Bromo-phenyl)-3-oxo-propionic acid | 1000556-86-4 | 2A-1168828 |
| tert-butyl (4-iodo-2-nitrophenyl)carbaMate | 335254-69-8 | 2A-1168829 |
| 称: 6-(3-iodo-phenyl)-2,2-dimethyl-[1,3]dioxin-4-one | 335256-29-6 | 2A-1168830 |
| 6,8,11-Trihydroxy-1-methoxy-5,12-naphthacenedione | 64845-67-6 | 2A-1168834 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA