
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 46258-62-2 |
| Catalog No. | 2A-1168755 |
| Chinese Name | 1-(4-溴-1-萘基)乙酮 |
| Synonyms | 4-bromo-1-acetonaphthone; CSVHMWORIJZGTJ-UHFFFAOYSA; 1-acetyl-4-bromo-naphthalene; 4-bromo-1-acetylnaphthalene |
| Molecular Formula | C12H9BrO |
| Molecular Weight | 249.10300 |
| Density | 1.454g/cm3 |
| Boiling Point | 370.2ºC at 760 mmHg |
| Melting Point | 50-51ºC |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2914700090 |
| PubChem ID | 86750 |
| SMILES | CC(=O)c1ccc(Br)c2ccccc12 |
| InChI | InChI=1S/C12H9BrO/c1-8(14)9-6-7-12(13)11-5-3-2-4-10(9)11/h2-7H,1H3 |
| InChI Key | CSVHMWORIJZGTJ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,2-DiMethyl-1,2,3,4-tetrahydroquinolin-7-aMine | 179899-22-0 | 2A-1168746 |
| 2,3-dichlorophenyl chlorothioformate | 2A-1168746 | 2A-1168746 |
| O-2-methoxyphenyl chlorothioformate | 2A-1168749 | 2A-1168749 |
| 4-Fluoro-3-[(4-fluorophenyl)carbonyl]benzenecarbonitrile | 395100-11-5 | 2A-1168752 |
| 17-Iodoandrosta-5,16-dien-3beta-ol | 32138-69-5 | 2A-1168750 |
| 2-CHLOROETHYL METHYL SULFIDE | 22599-69-5 | 2A-1168755 |
| 2-(2,2-difluorobenzo[d][1,3]dioxol-5-yl)acetonitrile | 68119-31-3 | 2A-1168757 |
| 1-(2,2-difluorobenzo[d][1,3]dioxol-5-yl)cyclopropanecarbonitrile | 862574-87-6 | 2A-1168758 |
| 6β,7β:15β,16β-DiMethylene-5β-hydroxy-3-oxo-17α- pregnane-21,17-carbolactone | 197721-70-3 | 2A-1168761 |
| triisopropylsilyl Methacrylate | 134652-60-1 | 2A-1168763 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA