
CAS Number62-97-5
SynonymsTalpran; Nivelona; Demotil; DIPHEMANIL METHYLSULFATE; Diphemanil Methylsulfate; Variton; Diphemanil metilsulfate; Diphemanil; 4-benzhydrylidene-1,1-dimethyl-piperidinium,methyl sulfate; 4-Benzhydryliden-1,1-dimethyl-piperidinium,Methylsulfat; 4-benzhydrylidene-1,1-dimethylpiperidin-1-ium,methyl sulfate; Prantal; Nivelon
Molecular FormulaC21H27O4N1S1
Molecular Weight389.52
Purity98.00%
Melting Point194-195ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 62-97-5 |
| Catalog No. | 2A-9016882 |
| Chinese Name | 甲硫二苯马尼 |
| Synonyms | Talpran; Nivelona; Demotil; DIPHEMANIL METHYLSULFATE; Diphemanil Methylsulfate; Variton; Diphemanil metilsulfate; Diphemanil; 4-benzhydrylidene-1,1-dimethyl-piperidinium,methyl sulfate; 4-Benzhydryliden-1,1-dimethyl-piperidinium,Methylsulfat; 4-benzhydrylidene-1,1-dimethylpiperidin-1-ium,methyl sulfate; Prantal; Nivelon |
| Molecular Formula | C21H27O4N1S1 |
| Molecular Weight | 389.52 |
| Purity | 98.00 |
| Melting Point | 194-195ºC |
| Storage Condition | Room temperature, dry |
| Application | Diphemanil dimethyl sulfate binds to muscarinic acetylcholine receptors and reduces gastric acid, saliva and sweat secretion. |
| MDL Number | MFCD00865157 |
| SMILES | COS(=O)(=O)[O-].C[N+]1(C)CCC(=C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H24N.CH4O4S/c1-21(2)15-13-19(14-16-21)20(17-9-5-3-6-10-17)18-11-7-4-8-12-18;1-5-6(2,3)4/h3-12H,13-16H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChI Key | BREMLQBSKCSNNH-UHFFFAOYSA-M |
| MSDS | msds/16882_1_62_97_5.pdf |
| Transport Info | Product name: Difenil methyl sulfate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Adrenalone hydrochloride | 62-13-5 | 2A-9016867 |
| EDTA calcium disodium | 62-33-9 | 2A-9016870 |
| Phenacetin | 62-44-2 | 2A-9016871 |
| Ethyl methanesulfonate | 62-50-0 | 2A-9016873 |
| Sodium oxalate | 62-76-0 | 2A-9016880 |
| 6,17-Dihydroxy-6b,17b-androst-4-en-3-one | 62-99-7 | 2A-9016883 |
| Carbaryl | 63-25-2 | 2A-9016885 |
| Lactose | 63-42-3 | 2A-9016888 |
| Sulfanilamide | 63-74-1 | 2A-9016891 |
| 4-Methylamphetamine; P-METHYLAMPHETAMINE | 64-11-9 | 2A-9016898 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA