
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 18355-80-1 |
| Catalog No. | 2A-9001688 |
| Chinese Name | 2,3-二氟苯乙酮 |
| Synonyms | FR BF CV1; MFCD00061274; 1-(2,3-Difluorophenyl)ethanone; 1-acetyl-2,3-difluorobenzene; 1-(2,3-Difluorophenyl)ethan-1-one |
| Molecular Formula | C8H6F2O |
| Molecular Weight | 156.129 |
| Purity | 97 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 193.4±20.0 °C at 760 mmHg |
| Storage Condition | Closed at room temperature, protected from light, |
| HTC | 2914700090 |
| SMILES | CC(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C8H6F2O/c1-5(11)6-3-2-4-7(9)8(6)10/h2-4H,1H3 |
| InChI Key | PQUXFUBNSYCQAL-UHFFFAOYSA-N |
| MSDS | msds/1688_1_18355_80_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,3-Dichlorophenylhydrazine hydrochloride | 21938-47-6 | 2A-9001673 |
| 2,3-Dichlorothiophenol | 17231-95-7 | 2A-9001678 |
| 2,3-Difluoro-4-methylbenzoyl chloride | 261763-38-6 | 2A-9001683 |
| 2,3-Difluoro-6-nitroanisole | 66684-65-9 | 2A-9001686 |
| 2,3-Difluoro-6-nitrophenol | 82419-26-9 | 2A-9001687 |
| 2,3-Difluoroaniline | 4519-40-8 | 2A-9001689 |
| 2,3-Difluoroanisole | 134364-69-5 | 2A-9001690 |
| 2,3-Difluorobenzamide | 18355-75-4 | 2A-9001692 |
| 2,3-Difluorobenzonitrile | 21524-39-0 | 2A-9001693 |
| 2,3-Difluorobenzoyl chloride | 18355-73-2 | 2A-9001694 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA