
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 611-64-3 |
| Catalog No. | 2A-1168630 |
| Chinese Name | 9-甲基吖啶 |
| Synonyms | 9-Methylacridine; EINECS 210-272-4 |
| Molecular Formula | C14H11N |
| Molecular Weight | 193.244 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 361.9±11.0 °C at 760 mmHg |
| Melting Point | 114-119ºC |
| Appearance | Yellow crystalline powder |
| Storage Condition | Storage: Seal the container and store it in a seal |
| HTC | 2933990090 |
| PubChem ID | 68075 |
| SMILES | Cc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C14H11N/c1-10-11-6-2-4-8-13(11)15-14-9-5-3-7-12(10)14/h2-9H,1H3 |
| InChI Key | FLDRLXJNISEWNZ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 96.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 9-Methyl acridine Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| para-Metolazone | 2A-1168617 | 2A-1168617 |
| Pentanoic acid, 1,4-phenylenebis(oxy- 2,1-ethanediyl) ester | 2A-1168618 | 2A-1168618 |
| racemic-1-hydroxy-1-oxo-2,5-trans-diphenylphospholane | 2A-1168620 | 2A-1168620 |
| trioctyl(hexadecyl)ammonium bromide | 2A-1168626 | 2A-1168626 |
| 2-(9-oxoacridin-10-yl)acetic acid | 58880-43-6 | 2A-1168629 |
| CB6139816 | 719-54-0 | 2A-1168633 |
| 9-Acridanone, 10-ethyl- | 2207-41-2 | 2A-1168634 |
| CARBAZINE | 92-81-9 | 2A-1168635 |
| Acridine, 2,7-dibroMo-9,10-dihydro-9,9-diMethyl- | 1333316-35-0 | 2A-1168636 |
| 4-CARBOXY-9-ACRIDANONE 96 | 24782-64-7 | 2A-1168637 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA