
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 431-05-0 |
| Catalog No. | 2A-1168422 |
| Chinese Name | 1,1-二氟丙酮 |
| Synonyms | 1,1-difluoropropan-2-one |
| Molecular Formula | C3H4F2O |
| Molecular Weight | 94.06010 |
| Density | 1.088 g/cm3 |
| Boiling Point | 45.3ºC at 760 mmHg |
| Appearance | colorless transparent liquid |
| Storage Condition | room temperature |
| HTC | 2914700090 |
| PubChem ID | 4699701 |
| SMILES | CC(=O)C(F)F |
| InChI | InChI=1S/C3H4F2O/c1-2(6)3(4)5/h3H,1H3 |
| InChI Key | XHILZHAQBOLGFD-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Industrial Applications | ||
|---|---|---|
| 2-[(2,6-dichlorophenyl)aminophenyl]methanol | 27204-57-5 | 2A-1168061 |
| 5-(2-aminoethyl)-2-hydroxy-benzenemethanol | 32551-66-9 | 2A-1168094 |
| Cyclohexane carbonitrile, 4-methyl | 524048-18-8 | 2A-1168195 |
| 1,3-Dimethyl-1h-pyrazol-5-yl)methanol | 57012-20-1 | 2A-1168228 |
| α-(1-methylethyl)-3-nitrobenzenemethanol | 5912-95-8 | 2A-1168234 |
| acridin-9-ylmethanol | 35426-11-0 | 2A-1168632 |
| 2-(2-bromopyridin-3-yloxy)ethanol | 313657-71-5 | 2A-1168793 |
| (2-Amino-cyclopentyl)-methanol | 359586-62-2 | 2A-1168835 |
| 1 4-DIMETHYLPYRIDINIUM P-TOLUENESULFONA& | 78105-28-9 | 2A-1168954 |
| m-Toluenesulfonic acid hydrate | 342385-54-0 | 2A-1169039 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA