
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 90734-55-7 |
| Catalog No. | 2A-1168414 |
| Chinese Name | 4-叔丁基苯氧基乙酰氯 |
| Synonyms | MFCD00798568; 2-(4-tert-butylphenoxy)acetyl chloride; 2-[4-(tert-Butyl)phenoxy]acetyl chloride |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.69900 |
| Density | 1.105g/cm3 |
| Boiling Point | 130-132 ºC (5 Torr) |
| Water Solubility | Very slightly soluble (0.12 g/L) (25 ºC) |
| Storage Condition | In a dry, cool, sealed place, in an inert gas envi |
| Packaging | II |
| HTC | 2918990090 |
| PubChem ID | 8697300 |
| SMILES | CC(C)(C)c1ccc(OCC(=O)Cl)cc1 |
| InChI | InChI=1S/C12H15ClO2/c1-12(2,3)9-4-6-10(7-5-9)15-8-11(13)14/h4-7H,8H2,1-3H3 |
| InChI Key | CFTNMBDQWVPSHI-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Bromo-6,7-dihydro-5H-cyclopenta[b]pyridine | 881204-65-5 | 2A-1168402 |
| 3-oxotetradecanoic acid | 88222-72-4 | 2A-1168403 |
| 3-Chloro-5-Methylpyrazin-2(1H)One | 89283-33-0 | 2A-1168407 |
| 2-(tert-butylamino)-1-(3-chloro-4-hydroxy-5-(hydroxymethyl)phenyl)ethanone | 898542-80-8 | 2A-1168409 |
| 3-azidobenzylamine | 902140-57-2 | 2A-1168411 |
| 3-(methylamino)benzamide | 90817-19-9 | 2A-0201172 |
| 3-Aminonaphthalen-1-ol | 90923-79-8 | 2A-1168416 |
| 3-Chloro-5-iodobenzyl bromide | 912343-41-0 | 2A-1168418 |
| 2-fluoro-3-(methoxycarbonyl)benzoic acid | 914301-44-3 | 2A-1168419 |
| Sodium cyanate | 917-63-3 | 2A-1168421 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA