
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 808760-02-3 |
| Catalog No. | 2A-1168367 |
| Chinese Name | 2-氨基-3-溴苯乙酮 |
| Synonyms | (2-Amino-3-bromophenyl)(phenyl)methanone; 2-AMINO-3-BROMOBENZOPHENONE; I14-8101 |
| Molecular Formula | C13H10BrNO |
| Molecular Weight | 276.129 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 425.5±35.0 °C at 760 mmHg |
| HTC | 2922399090 |
| PubChem ID | 62642661 |
| SMILES | CC(=O)c1cccc(Br)c1N |
| InChI | InChI=1S/C8H8BrNO/c1-5(11)6-3-2-4-7(9)8(6)10/h2-4H,10H2,1H3 |
| InChI Key | DCHRSZPALFRBOX-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-BROMOPHENOL ACETATE | 1927-95-3 | 2A-1168359 |
| 2,2-DIPHENYLPROPIONIC ACID | 5558-66-7 | 2A-1168360 |
| POLY(ETHYLENE-CO-1-BUTENE) | 25087-34-7 | 2A-1168361 |
| YTTRIUM(III) ISOPROPOXIDE | 2172-12-5 | 2A-1168362 |
| 2-(3-ethoxy-2-oxocyclohex-3-enyl)-2-oxoacetate | 802541-12-4 | 2A-1168365 |
| 5-(propylsulfanyl)-1H-benzimidazol-2-amine | 80983-36-4 | 2A-1168368 |
| 5-CHLORO-4-METHYL-PENTANOYL CHLORIDE | 813452-05-0 | 2A-1168369 |
| 2-chloro-1,3- diphenyl-1,3,2-diazaphospholidine | 82017-87-6 | 2A-1168371 |
| Cyclopropanecarbonitrile, 1-(5-bromo-2-pyridinyl) | 827628-15-9 | 2A-1168376 |
| 5-bromo-2,2-dimethylpentanoic acid | 82884-95-5 | 2A-1168377 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA