CAS Number779-81-7
SynonymsMethyl 3-(3-methoxyphenyl)-3-oxopropanoate; AB1489; methyl 3-(3-methoxyphenyl)-3-oxopropionate; 3-Methoxy-benzoylessigsaeuremethylester; Benzenepropanoic acid, 3-methoxy-β-oxo-, methyl ester; methyl 3-methoxybenzoylacetate; 3-(3-Methoxyphenyl)-3-oxo-propionicacidmethylester
Molecular FormulaC11H12O4
Molecular Weight208.211
Density1.1±0.1 g/cm3
Boiling Point289.9±15.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 779-81-7 |
| Catalog No. | 2A-1168352 |
| Chinese Name | 3-(3-甲氧基苯基)-3-羰基丙酸甲酯 |
| Synonyms | Methyl 3-(3-methoxyphenyl)-3-oxopropanoate; AB1489; methyl 3-(3-methoxyphenyl)-3-oxopropionate; 3-Methoxy-benzoylessigsaeuremethylester; Benzenepropanoic acid, 3-methoxy-β-oxo-, methyl ester; methyl 3-methoxybenzoylacetate; 3-(3-Methoxyphenyl)-3-oxo-propionicacidmethylester |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.211 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 289.9±15.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2918990090 |
| PubChem ID | 3187188 |
| SMILES | COC(=O)CC(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C11H12O4/c1-14-9-5-3-4-8(6-9)10(12)7-11(13)15-2/h3-6H,7H2,1-2H3 |
| InChI Key | LWDDRIZJCLYGJZ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,4,6-Trifluorophenacylbromide | 746630-36-4 | 2A-1168338 |
| N-Formyl-N-methylhydrazine | 758-17-8 | 2A-1168341 |
| SULFUR TRIOXIDE-TRIETHYLAMINE | 761-01-3 | 2A-1168342 |
| 5-fluoro-2-nitrobenzamide | 77206-97-4 | 2A-1168347 |
| dimethyl 2-(3-bromophenyl) malonate | 773134-24-0 | 2A-1168349 |
| 2-hydroxy-N-methoxy-N-methylacetamide | 78937-02-7 | 2A-1168355 |
| Ethyl 4,4,4-trifluoro-2-butynoate | 79424-03-6 | 2A-1168358 |
| 4-BROMOPHENOL ACETATE | 1927-95-3 | 2A-1168359 |
| 2,2-DIPHENYLPROPIONIC ACID | 5558-66-7 | 2A-1168360 |
| POLY(ETHYLENE-CO-1-BUTENE) | 25087-34-7 | 2A-1168361 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS