
CAS Number73635-75-3
Synonyms3,4-Dihydroxy-6-nitrobenzaldehyde; 5-dihydroxy-2-nitrobenzaldehyde; 4-dihydroxy-6-nitrobenzaldehyde; 4,5-Dihydroxy-2-nitrobenzaldehyde; WNR CQ DQ FVH; 6-nitroprotocatechualdehyde; 6-nitroprotocatecualdehyde
Molecular FormulaC7H5NO5
Molecular Weight183.118
Density1.7±0.1 g/cm3
Boiling Point417.0±45.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 73635-75-3 |
| Catalog No. | 2A-1168334 |
| Chinese Name | 4,5-二羟基-2-硝基苯甲醛 |
| Synonyms | 3,4-Dihydroxy-6-nitrobenzaldehyde; 5-dihydroxy-2-nitrobenzaldehyde; 4-dihydroxy-6-nitrobenzaldehyde; 4,5-Dihydroxy-2-nitrobenzaldehyde; WNR CQ DQ FVH; 6-nitroprotocatechualdehyde; 6-nitroprotocatecualdehyde |
| Molecular Formula | C7H5NO5 |
| Molecular Weight | 183.118 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 417.0±45.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, inert gas atmosphere |
| HTC | 2913000090 |
| PubChem ID | 3159096 |
| SMILES | O=Cc1cc(O)c(O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H5NO5/c9-3-4-1-6(10)7(11)2-5(4)8(12)13/h1-3,10-11H |
| InChI Key | SDAAKNQPCGUCNH-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-methyl-4-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)aniline | 590418-05-6 | 2A-1168233 |
| 4-((4-ethylpiperazin-1-yl)methyl)-3-(trifluoromethyl)aniline | 630125-91-6 | 2A-1168270 |
| 1-methylcyclobutane-1-carbaldehyde | 65338-30-9 | 2A-1168278 |
| 2,5-Dimethyl-3-nitrobenzaldehyde | 69022-52-2 | 2A-1168317 |
| (2S)-2-(Bromomethyl)-2-ethylhexanoic acid | 711603-76-8 | 2A-1168325 |
| 1-(4-hydroxy-phenyl)-cyclopropanecarboxylic acid methyl ester | 779199-69-8 | 2A-1168350 |
| Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methane | 78782-17-9 | 2A-1168354 |
| 3-Chloro-2,2-Bis(Chloromethyl)Propan-1-ol | 813-99-0 | 2A-1168370 |
| 7,9-ditert-butyl-1-oxaspiro[4.5]deca-6,9-diene-2,8-dione | 82304-66-3 | 2A-1168372 |
| 1-(4-hydroxyphenyl)cyclopropane-1-carboxylic acid | 869970-25-2 | 2A-1168385 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA