
CAS Number58012-34-3
SynonymsCyclohexaneacetic acid, 4-oxo-, ethyl ester; Ethyl (4-oxocyclohexyl)acetate; ethyl 2-(4-oxocyclohexyl)acetate; 4-Oxocyclohexaneacetic acid ethyl ester
Molecular FormulaC10H16O3
Molecular Weight184.232
Density1.0±0.1 g/cm3
Boiling Point265.5±13.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 58012-34-3 |
| Catalog No. | 2A-1168230 |
| Chinese Name | 4-氧代环己烷乙酸乙酯 |
| Synonyms | Cyclohexaneacetic acid, 4-oxo-, ethyl ester; Ethyl (4-oxocyclohexyl)acetate; ethyl 2-(4-oxocyclohexyl)acetate; 4-Oxocyclohexaneacetic acid ethyl ester |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.232 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 265.5±13.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2918300090 |
| PubChem ID | 30277647 |
| SMILES | CCOC(=O)CC1CCC(=O)CC1 |
| InChI | InChI=1S/C10H16O3/c1-2-13-10(12)7-8-3-5-9(11)6-4-8/h8H,2-7H2,1H3 |
| InChI Key | XHNJFNLTFMAPQB-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4,4-Diphenylbutan-1-ol | 56740-71-7 | 2A-1168224 |
| Benzenamine, 2,5-dimethoxy-3-nitro | 56741-29-8 | 2A-1168225 |
| ((3E)-5-ethoxyhexa-1,3-diene) | 56752-55-7 | 2A-1168226 |
| 4-Bromo-2-methylbutylacetate | 56761-59-2 | 2A-1168227 |
| 4-Phenoxymethyl-aniline | 57181-90-5 | 2A-1168229 |
| 3-methoxy-5-[2-(4-methoxyphenyl)ethenyl]phenol | 58436-29-6 | 2A-1168231 |
| 2,2-dibromopropanoic acid | 594-48-9 | 2A-1168236 |
| 2,2-Dichloro-3,3-dimethyl butane | 594-84-3 | 2A-1168237 |
| 9-Aminofluorene HCl | 5978-75-6 | 2A-1168238 |
| 2-Bromoallyl Alcohol | 598-19-6 | 2A-1168239 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA