
CAS Number3706-26-1
Synonyms1-(4-Methoxyphenyl)-2-propanamine hydrochloride (1:1); Benzeneethanamine, 4-methoxy-α-methyl-, hydrochloride (1:1); 4-methoxyamphetamine hydrochloride; p-Methoxyamphetamine hydrochloride; Phenethylamine, 4-methoxy-α-methyl-, hydrochloride
Molecular FormulaC10H16ClNO
Molecular Weight201.693
Density0.99g/cm3
Boiling Point258.2ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3706-26-1 |
| Catalog No. | 2A-1168123 |
| Chinese Name | 4-Methoxyamphetamine (hydrochloride) (exempt preparation) |
| Synonyms | 1-(4-Methoxyphenyl)-2-propanamine hydrochloride (1:1); Benzeneethanamine, 4-methoxy-α-methyl-, hydrochloride (1:1); 4-methoxyamphetamine hydrochloride; p-Methoxyamphetamine hydrochloride; Phenethylamine, 4-methoxy-α-methyl-, hydrochloride |
| Molecular Formula | C10H16ClNO |
| Molecular Weight | 201.693 |
| Density | 0.99g/cm3 |
| Boiling Point | 258.2ºC at 760mmHg |
| HTC | 2922299090 |
| PubChem ID | 10243867 |
| SMILES | [H+].[Cl-].COc1ccc(CC(C)N)cc1 |
| InChI | InChI=1S/C10H15NO.ClH/c1-8(11)7-9-3-5-10(12-2)6-4-9;/h3-6,8H,7,11H2,1-2H3;1H |
| InChI Key | InChIKey=VSHZXOLHFRVZND-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 7-Nitro-2,3,4,5-tetrahydro-1H-3-benzazepine | 34583-83-0 | 2A-1168113 |
| Ethyl 2-(4-bromonaphthalen-1-yl)acetate | 34841-59-3 | 2A-1168114 |
| 1-IODOTRIDECAN | 35599-77-0 | 2A-1168117 |
| 4-(4-chlorophenyl)-3,4-dihydronaphthalen-1(2H)-one | 36159-73-6 | 2A-1168120 |
| Dimethyl 3-hydroxyphthalate | 36669-02-0 | 2A-1168121 |
| 6,13-Bis(triisopropylsilylethynyl)pentacene | 373596-08-8 | 2A-1168124 |
| 1-o-tolylguanidine | 37557-40-7 | 2A-1168125 |
| (2E)-2-cyano-3-(3,4-dimethoxyphenyl)prop-2-enoic acid | 37630-52-7 | 2A-1168126 |
| 2-Bromo-1-(4-Dimethylaminophenyl)Ethanone | 37904-72-6 | 2A-1168127 |
| 4-phenoxy-phthalic acid | 37951-15-8 | 2A-1168128 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA