
CAS Number299-75-2
SynonymsTresulfan; L-threitol 1,4-bismethane sulfonate; Dihydroxymyleran; L-Dihydroxy-Busulfan; 1,2,3,4-Butanetetrol, 1,4-dimethanesulfonate; 2,3-dihydroxybutane-1,4-diyl dimethanesulfonate; Dihydroxybusulfan; Treosulfan; Treosulphan; THREOSULFAN; CB-2562; 2,3-Dihydroxy-1,4-butanediyl dimethanesulfonate
Molecular FormulaC6H14O8S2
Molecular Weight278.301
Density1.6±0.1 g/cm3
Boiling Point607.0±55.0 °C at 760 mmHg
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 299-75-2 |
| Catalog No. | 2A-1168082 |
| Chinese Name | 曲奥舒凡 |
| Synonyms | Tresulfan; L-threitol 1,4-bismethane sulfonate; Dihydroxymyleran; L-Dihydroxy-Busulfan; 1,2,3,4-Butanetetrol, 1,4-dimethanesulfonate; 2,3-dihydroxybutane-1,4-diyl dimethanesulfonate; Dihydroxybusulfan; Treosulfan; Treosulphan; THREOSULFAN; CB-2562; 2,3-Dihydroxy-1,4-butanediyl dimethanesulfonate |
| Molecular Formula | C6H14O8S2 |
| Molecular Weight | 278.301 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 607.0±55.0 °C at 760 mmHg |
| Storage Condition | 2-8℃ |
| Packaging | III |
| Application | Treosulfan (NSC 39069; Treosulphan) is an alkylating agent that has inhibitory effects on ovarian cancer and other solid tumors. |
| PubChem ID | 14848649 |
| SMILES | CS(=O)(=O)OCC(O)C(O)COS(C)(=O)=O |
| InChI | InChI=1S/C6H14O8S2/c1-15(9,10)13-3-5(7)6(8)4-14-16(2,11)12/h5-8H,3-4H2,1-2H3 |
| InChI Key | YCPOZVAOBBQLRI-WDSKDSINSA-N |
| Hazard Symbols | 6.1(b) |
| Transport Info | Product name: Qu'ao Shufan |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Acetylamino-2-{(2-oxo-1,2-dihydroquinolin -4-yl) methyl}malonate diethyl | 2A-1168074 | 2A-1168074 |
| N/A | 2A-1168075 | 2A-1168075 |
| 4-AMINO-2-FLUORO-N-METHYLBENZAMIDE | 915087-25-1 | 2A-1168078 |
| 5-(benzyl amino)pentan-1-ol | 2937-99-7 | 2A-1168080 |
| 3,6-Octanedione | 2955-65-9 | 2A-1168081 |
| 2-bromo-9,9-dioctyl fluorene | 302554-80-9 | 2A-1168084 |
| tert-Butyl ethyl(2-oxoethyl)carbamate | 315718-06-0 | 2A-1168089 |
| 2-methoxybenzene-1,3-diamine | 32114-60-6 | 2A-1168091 |
| ethyl 2-phenylmethoxyacetate | 32122-09-1 | 2A-1168092 |
| 1,1-Dimethyl-1,3-Dihydro-2,1-Benzoxasilole | 321903-29-1 | 2A-1168093 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA