
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 16357-40-7 |
| Catalog No. | 2A-1167931 |
| Chinese Name | 3-乙酰基-4-羟基苯甲酸 |
| Synonyms | 3-acetyl-4-hydroxy-benzoic acid; 3-Acetyl-4-hydroxy-benzoesaeure |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.15700 |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2918990090 |
| PubChem ID | 16081627 |
| SMILES | CC(=O)c1cc(C(=O)O)ccc1O |
| InChI | InChI=1S/C9H8O4/c1-5(10)7-4-6(9(12)13)2-3-8(7)11/h2-4,11H,1H3,(H,12,13) |
| InChI Key | FPBXWXGOFQSROI-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (2S)-2-Piperazineacetonitrile | 1589082-26-7 | 2A-1167921 |
| 3-Methoxy-4-(4-pyridinyl)benzenamine | 1610875-32-5 | 2A-1167924 |
| 5-METHOXY-2-NITRO-N-(2-PIR | 1616693-67-4 | 2A-1167926 |
| 2-Iodo-N-methoxy-N-methylacetamide | 163089-33-6 | 2A-1167929 |
| 1-Bromoheptan-2-One | 16339-93-8 | 2A-1167930 |
| 3-Bromo-4'-chlorobiphenyl | 164334-69-4 | 2A-1167933 |
| 2-methylidenebutanenitrile | 1647-11-6 | 2A-1167936 |
| RGH188 hydrochloride | 1083076-69-0 | 2A-1167942 |
| 1-(Tetrahydro-2H-pyran-4-yl)-1-propanone | 855235-50-6 | 2A-1167944 |
| tert-butyl dimethylcarbamate | 7541-17-5 | 2A-1167948 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA