
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13989-27-0 |
| Catalog No. | 2A-1167879 |
| Chinese Name | 2-fluoroacrolein |
| Synonyms | 2-Fluoroacrylaldehyde; 2-Propenal,2-fluoro; 2-fluoro-propenal; 2-Fluoro-2-propenal; 2-Fluoroacrolein |
| Molecular Formula | C3H3FO |
| Molecular Weight | 74.05370 |
| Density | 0.977g/cm3 |
| Boiling Point | 63ºC at 760mmHg |
| HTC | 2913000090 |
| PubChem ID | 10251298 |
| SMILES | C=C(F)C=O |
| InChI | InChI=1S/C3H3FO/c1-3(4)2-5/h2H,1H2 |
| InChI Key | MQBNWHZGDKLEHL-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde | 1246633-35-1 | 2A-1167816 |
| 3-Pyridinecarboxylic acid, 4-bromo-6-chloro-methyl ester | 1256790-93-8 | 2A-1167817 |
| 2-chloro-3-fluoro-6-hydroxybenzaldehyde | 1263378-00-2 | 2A-1167829 |
| 2-chloro-3-fluoro-6-methoxy-benzaldehyde | 1263378-40-0 | 2A-1167831 |
| 5-bromo-3-(trifluoromethyl)pyrazin-2-amine | 1360552-59-5 | 2A-1167869 |
| 2,2-Difluorocyclohexane-1-Carboxylic Acid | 1461714-25-9 | 2A-1167896 |
| 3-(Trifluoromethyl)cyclohexanecarbaldehyde | 1461715-02-5 | 2A-1167897 |
| 4,5-bis-(Chloromethyl)-1,3-dioxolan-2-one | 1487-64-5 | 2A-1167902 |
| 3-Iodo-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazole-4-carbaldehyde | 1627924-19-9 | 2A-1167928 |
| tert-butyl-N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)allyl]carbamate | 1202794-01-1 | 2A-1167946 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA