
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 126811-29-8 |
| Catalog No. | 2A-1167638 |
| Chinese Name | 7-溴-4-氯-1H-吲哚 |
| Synonyms | rw3747; 7-Bromo-4-chloro-1H-indole; 4-chloro-7-bromoindole |
| Molecular Formula | C8H5BrClN |
| Molecular Weight | 230.489 |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 345.8±22.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, dry and sealed |
| HTC | 2933990090 |
| PubChem ID | 31057266 |
| SMILES | Clc1ccc(Br)c2[nH]ccc12 |
| InChI | InChI=1S/C8H5BrClN/c9-6-1-2-7(10)5-3-4-11-8(5)6/h1-4,11H |
| InChI Key | ZFBAFEMIPJPWPF-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 7-(but-2-yn-1-yl)-3-methyl-1-((4-methylquinazolin-2-yl)methyl)-1H-purine-2,6(3H,7H)-dione | 2A-1167629 | 2A-1167629 |
| 2-bromo-1-tosyl-1H-imidazole | 2A-1167630 | 2A-1167630 |
| 8-bromo-1-(but-2-yn-1-yl)-7-(4-methoxybenzyl)-3-methyl-1H-purine-2,6(3H,7H)-dione | 2A-1167631 | 2A-1167631 |
| 1H-Indole-4-carboxylic acid, 6-fluoro- | 908600-71-5 | 2A-1167635 |
| 6-Fluoro-1H-indole-4-carboxylic acid methyl ester | 1082040-43-4 | 2A-1167637 |
| 2,6 - diMethyl-7 - azaindole | 2A-1167639 | 2A-1167639 |
| 6-fluoro-5-methoxy-1H-indole | 63762-83-4 | 2A-1167640 |
| Methyl 7-Methyl-1H-indole-4-carboxylate | 2A-1167642 | 2A-1167642 |
| 5,7-DiMethyl-4-nitro indole | 1190314-35-2 | 2A-1167643 |
| 4-Chloro-2-Methyl-1H-pyrrolo[3,2-c]pyridine | 854018-87-4 | 2A-1167645 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA