
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 78242-20-3 |
| Catalog No. | 2A-1167623 |
| Chinese Name | 1-甲基-4-羟基-1H-吡唑 |
| Synonyms | 1-Methyl-1H-pyrazol-4-ol; 1H-Pyrazol-4-ol,1-methyl; Y5106 |
| Molecular Formula | C4H6N2O |
| Molecular Weight | 98.10320 |
| Boiling Point | 217.7±13.0°C at 760 mmHg |
| Storage Condition | 2-8°C, protected from light, stored in inert gas |
| HTC | 2933199090 |
| PubChem ID | 127883110 |
| SMILES | Cn1cc(O)cn1 |
| InChI | InChI=1S/C4H6N2O/c1-6-3-4(7)2-5-6/h2-3,7H,1H3 |
| InChI Key | FQASUNMXKLPOOF-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-isobutyl-1H-indole-2,3-dione | 78846-77-2 | 2A-1167613 |
| 3-aminonaphthalene-1,5-disulphonic acid, sodium salt | 52085-24-2 | 2A-1167616 |
| 1-(3-Acetyl-4-hydroxyphenyl)ethanone | 30186-16-4 | 2A-1167618 |
| Methyl 2-(4- Bromophenyl )Propanoate | 83636-46-8 | 2A-1167621 |
| 1-(5-bromo-4-Methyl pyridin-2-yl)hydrazine | 913839-67-5 | 2A-1167622 |
| 2-(piperidin-3-yl)acetonitrile hydrochloride | 2A-1167626 | 2A-1167626 |
| Ethyl (2-aminothiazol-4-yl)acetate hydrochloride | 76629-17-9 | 2A-1167627 |
| 3,5-dibromo-4-methylpyridin-2-amine compound with 5-bromo-4-methylpyridin-2-amine | 2A-1167632 | 2A-1167632 |
| 4-bromo-1H-pyrazol-3-amine | 2A-1167635 | 2A-1167635 |
| 1,2-dimethyl-5-nitrocyclopenta-1,3-diene | 2A-1167636 | 2A-1167636 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA