
CAS Number1081-15-8
SynonymsFormaldehyde-2,4-DNPH; Formaldehyde-2,4-dinitrophenylhydrazone; N-(methylideneamino)-2,4-dinitroaniline; MFCD00191364; ForMaldehyde 2,4-Dinitrophenylhydrazone
Molecular FormulaC7H6N4O4
Molecular Weight210.14700
Density1.54g/cm3
Boiling Point357.8ºC at 760mmHg
Melting Point153-156ºC
AppearanceSolid;Orange to Brown powder to crystal
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1081-15-8 |
| Catalog No. | 2A-1167603 |
| Chinese Name | 甲醛2,4-二硝基苯腙 |
| Synonyms | Formaldehyde-2,4-DNPH; Formaldehyde-2,4-dinitrophenylhydrazone; N-(methylideneamino)-2,4-dinitroaniline; MFCD00191364; ForMaldehyde 2,4-Dinitrophenylhydrazone |
| Molecular Formula | C7H6N4O4 |
| Molecular Weight | 210.14700 |
| Density | 1.54g/cm3 |
| Boiling Point | 357.8ºC at 760mmHg |
| Melting Point | 153-156ºC |
| Appearance | Solid;Orange to Brown powder to crystal |
| Storage Condition | Sealed storage at 0-6°C |
| Packaging | III |
| HTC | 2928000090 |
| PubChem ID | 100999 |
| SMILES | C=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H6N4O4/c1-8-9-6-3-2-5(10(12)13)4-7(6)11(14)15/h2-4,9H,1H2 |
| InChI Key | UEQLSLWCHGLSML-UHFFFAOYSA-N |
| Hazard Symbols | 4.1 |
| MSDS | msds/167636_2_1081_15_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Division 1 Flammable solids. UN number: 1325 Formal shipping name: Combustible solid, organic, not otherwise specified. Packing grade: III |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 5-chloro-2,4-dimethoxynicotinonitrile | 2A-1167480 | 2A-1167480 |
| ethyl 4-(4-(dimethylamino)phenyl)-2,4-dioxobutanoate | 117937-10-7 | 2A-1167503 |
| tert-butyl 2,4-dioxo-1,3,7-triazaspiro[4.4]nonane-7-carboxylate | 1391738-60-5 | 2A-1167507 |
| ethyl 4-cyclopropyl-2,4-dioxobutanoate | 21080-80-8 | 2A-1167514 |
| 5-bromo-2,4-dichlorobenzoic acid | 791137-20-7 | 2A-1167521 |
| 2,4-Dichloro-5-[2-(Trimethylsilyl) Ethynyl]-Pyrimidine | 514843-06-2 | 2A-1167612 |
| 2,4-DIFLUORO-3-NITROBENZO | 1186194-75-1 | 2A-1167776 |
| 1-(2,4-Dichloro-3-pyridinyl)ethanone | 1246349-89-2 | 2A-1167815 |
| Triflumezopyrim | 1263133-33-0 | 2A-1167828 |
| 1-(2,4,5-TRIHYDROXYPHENYL)-1-BUTANONE | 1421-63-2 | 2A-1167887 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA