
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7377-13-1 |
| Catalog No. | 2A-1167526 |
| Chinese Name | 4-(4-硝基苄基)-苯甲酸 |
| Synonyms | p-Carboxy-p'-nitro-benzophenon |
| Molecular Formula | C14H9NO5 |
| Molecular Weight | 271.22500 |
| Density | 1.413g/cm3 |
| Boiling Point | 509.6ºC at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2918300090 |
| PubChem ID | 126151 |
| SMILES | O=C(O)c1ccc(C(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C14H9NO5/c16-13(9-1-3-11(4-2-9)14(17)18)10-5-7-12(8-6-10)15(19)20/h1-8H,(H,17,18) |
| InChI Key | FGGHZEMNYJKTDV-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,4,5,6-tetrachlorobenzene-1,2-diol | 1198-55-6 | 2A-1167519 |
| 2-chloroethyl sulfurochloridite | 41239-98-9 | 2A-1167520 |
| 8-bromo-7-(4-methoxybenzyl)-3-methyl-1,2,3,7,8,9-hexahydro-6H-purin-6-one | 2A-1167522 | 2A-1167522 |
| 3,4,5-tri-tert-butylbenzoic acid | 66415-27-8 | 2A-1167523 |
| 2-(4-nitrobenzoyl)benzoic acid | 20643-62-3 | 2A-1167525 |
| 4-amino-2-bromo-5-methylphenol | 1195190-04-5 | 2A-1167528 |
| ethyl 4-(5-(bis(2-chloroethyl)amino)-1-methyl-4-nitro-1H-benzo[d]imidazol-2-yl)butanoate | 2A-1167531 | 2A-1167531 |
| ethyl 4-(4-amino-5-(bis(2-chloroethyl)amino)-1-methyl-1H-benzo[d]imidazol-2-yl)butanoate | 2A-1167532 | 2A-1167532 |
| tert-butyl (4-(oxetan-3-yl)pyridin-2-yl)carbamate | 2A-1167539 | 2A-1167539 |
| 4-(oxetan-3-yl)pyridin-2-amine | 1427501-89-0 | 2A-1167540 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA