CAS Number151982-51-3
Synonyms4-Bromo-2-fluoro-benzoyl chloride; MFCD03411584; 4-bromo-2-fluorobenzoic acid chloride; 4-Bromo-2-fluorobenzoyl chloride; 2-Fluoro-4-Bromobenzoyl Chloride
Molecular FormulaC7H3BrClFO
Molecular Weight237.454
Density1.7±0.1 g/cm3
Boiling Point236.9±20.0 °C at 760 mmHg
Melting Point24-24.5ºC
AppearanceWhite to light yellow liquid or crystalline mass
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 151982-51-3 |
| Catalog No. | 2A-1167308 |
| Chinese Name | 4-溴-2-氟苯甲酰氯 |
| Synonyms | 4-Bromo-2-fluoro-benzoyl chloride; MFCD03411584; 4-bromo-2-fluorobenzoic acid chloride; 4-Bromo-2-fluorobenzoyl chloride; 2-Fluoro-4-Bromobenzoyl Chloride |
| Molecular Formula | C7H3BrClFO |
| Molecular Weight | 237.454 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 236.9±20.0 °C at 760 mmHg |
| Melting Point | 24-24.5ºC |
| Appearance | White to light yellow liquid or crystalline mass |
| Storage Condition | Store under inert gas; avoid air, moisture (decomp |
| Packaging | II |
| HTC | 2916399090 |
| PubChem ID | 3154303 |
| SMILES | O=C(Cl)c1ccc(Br)cc1F |
| InChI | InChI=1S/C7H3BrClFO/c8-4-1-2-5(7(9)11)6(10)3-4/h1-3H |
| InChI Key | PCFIABOQFAFDAU-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/167333_2_151982_51_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-bromo-6-methylpyrimidin-4(3H)-one | 252566-49-7 | 2A-1167299 |
| 1-((6-bromo-2-nitropyridin-3-yl)oxy)decane-2,3-dione | 80456-81-1 | 2A-1167302 |
| METHYL (2E)-2-(HYDROXYIMINO)PROPANOATE | 199434-50-9 | 2A-1167303 |
| Cyclopropanecarboxylic acid, 2-fluoro-, (1R-trans)- (9CI) | 167073-08-7 | 2A-1167306 |
| Methyl 2-chloro-5-cyanonicotinate | 1256785-53-1 | 2A-1167307 |
| 5,5-Diethoxy-1-pentanol | 18545-17-0 | 2A-1167310 |
| (Z)-4-fluoro-N-hydroxybenzimidoyl chloride | 42202-95-9 | 2A-1167317 |
| (6-oxocyclohexa-1,4-diene-1-carbonyl)glycine | 2A-1167318 | 2A-1167318 |
| tert-butyl (3-(ethylamino)-2-oxopropyl)carbamate | 2A-1167319 | 2A-1167319 |
| tert-butyl (5-methoxy-4-oxohexan-3-yl)carbamate | 2A-1167321 | 2A-1167321 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS