CAS Number25173-37-9
Synonyms3-(4-Methylphenoxy)propionic acid; EINECS 217-678-0; 2-(p-tolyloxy)propionic acid; 3-p-Tolyloxy-propionsaeure; Propanoic acid,3-(4-methylphenoxy); F1575-0108; MFCD00002777; 3-p-tolyloxy-propionic acid; Propanoicacid,3-(4-methylphenoxy)
Molecular FormulaC10H12O3
Molecular Weight180.20000
Density1.144 g/cm3
Boiling Point318.5ºC at 760 mmHg
Melting Point98-100ºC(lit.)
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 25173-37-9 |
| Catalog No. | 2A-1167256 |
| Chinese Name | 3-(对甲苯氧基)丙酸 |
| Synonyms | 3-(4-Methylphenoxy)propionic acid; EINECS 217-678-0; 2-(p-tolyloxy)propionic acid; 3-p-Tolyloxy-propionsaeure; Propanoic acid,3-(4-methylphenoxy); F1575-0108; MFCD00002777; 3-p-tolyloxy-propionic acid; Propanoicacid,3-(4-methylphenoxy) |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20000 |
| Density | 1.144 g/cm3 |
| Boiling Point | 318.5ºC at 760 mmHg |
| Melting Point | 98-100ºC(lit.) |
| Appearance | solid |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2918990090 |
| PubChem ID | 422831 |
| SMILES | Cc1ccc(OCCC(=O)O)cc1 |
| InChI | InChI=1S/C10H12O3/c1-8-2-4-9(5-3-8)13-7-6-10(11)12/h2-5H,6-7H2,1H3,(H,11,12)/p-1 |
| InChI Key | GNPISAHACGIXLZ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Bromo-6-methoxy-2,3-dihydro-1H-inden-1-one | 187872-11-3 | 2A-1167250 |
| 2-imidazolidinone Aqueous solution | 2A-1167252 | 2A-1167252 |
| 2-Propenoic acid, 2-Methyl-, (2-oxo-1,3-dioxolan-4-yl)Methyl ester | 13818-44-5 | 2A-1167253 |
| N-chloro-1-(4-hydroxyphenyl)methanaminium | 2A-1167254 | 2A-1167254 |
| 6-nitro-2H-5l5-benzo[d][1,3]oxazine-2,4,5(1H)-trione | 2A-1167255 | 2A-1167255 |
| 2-(2-(1,3-dioxolan-2-yl)phenyl)-4,4,6,6-tetramethyl-1,3,2-dioxaborinane | 2A-1167257 | 2A-1167257 |
| 4-(pyridin-3-yl)benzonitrile | 294648-03-6 | 2A-1167261 |
| N-chloro-2-oxopentan-3-aminium | 40874-33-7 | 2A-1167263 |
| 4-methoxy-3-sulfamoylbenzoic acid | 20532-06-3 | 2A-1167264 |
| 4-bromo-N-hydroxybenzamide | 1836-27-7 | 2A-1167266 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS