
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 364757-36-8 |
| Catalog No. | 2A-1167197 |
| Chinese Name | 2-肼基-4-氯吡啶 |
| Synonyms | 4-chloro-2-pyridylhydrazine; 4-Chloro-2-Hydrazinopyridine; 4-Chloro-2-hydrazinylpyridine; 4-hydrazine 2-chloropyridine |
| Molecular Formula | C5H6ClN3 |
| Molecular Weight | 143.57400 |
| Boiling Point | 221.6±50.0 °C at 760 mmHg |
| Appearance | white to yellow solid |
| Storage Condition | -20°C, protected from light, inert gas |
| HTC | 2933990090 |
| PubChem ID | 120159326 |
| SMILES | NNc1cc(Cl)ccn1 |
| InChI | InChI=1S/C5H6ClN3/c6-4-1-2-8-5(3-4)9-7/h1-3H,7H2,(H,8,9) |
| InChI Key | QXWOSVIWAQWADL-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-Methyl-8-(pyridin-2-yl)benzofuro[2,3-b]pyridine | 1609373-99-0 | 2A-1167162 |
| Phosphine oxide, 1,1-(2,8-dibenzofurandiyl)bis[1,1-diphenyl- | 911397-27-8 | 2A-1167169 |
| 5-bromo-3-fluoro-2-nitropyridine | 1532517-95-5 | 2A-1167184 |
| methyl 5-bromo-3-formyl-1H-indole-4-carboxylate | 731810-05-2 | 2A-1167195 |
| methyl 6-bromo-3-formyl-1H-indole-4-carboxylate | 1353636-63-1 | 2A-1167196 |
| tert-butyl 3-(2-oxo-3,4-dihydroquinazolin-1(2H)-yl)azetidine-1-carboxylate | 10020-07-31 | 2A-1167204 |
| 2-(2-oxocyclobutyl)isoindoline-1,3-dione | 2A-1167206 | 2A-1167206 |
| 1-(bis(phosphanyl)methyl)azetidine-3-thiol | 2A-1167207 | 2A-1167207 |
| 2-(5-BroMo-2-Methylbenzyl)-5-(4-fluorophenyl)thiophene | 1030825-20-7 | 2A-1167218 |
| 8-bromo-1-(imidazolidin-2-ylmethyl)-3-methyl-7-(4-methylquinazolin-2-yl)-3,4,5,7-tetrahydro-1H-purine-2,6-dione | 2A-1167220 | 2A-1167220 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA