
CAS Number134724-87-1
SynonymsN-(Phth)-AOGly-OH; phthalmidooxyacetic acid; PhthN-O-Gly-OH; 2-((1,3-dioxoisoindolin-2-yl)oxy)acetic acid; phthalimidooxyacetic acid; phthalimido-aminooxyacetic acid; Pht-Aoaa-OH; Acetic acid,[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]
Molecular FormulaC10H7NO5
Molecular Weight221.16600
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 134724-87-1 |
| Catalog No. | 2A-1167135 |
| Chinese Name | 2-Phthalimidehydroxy-acetic acid |
| Synonyms | N-(Phth)-AOGly-OH; phthalmidooxyacetic acid; PhthN-O-Gly-OH; 2-((1,3-dioxoisoindolin-2-yl)oxy)acetic acid; phthalimidooxyacetic acid; phthalimido-aminooxyacetic acid; Pht-Aoaa-OH; Acetic acid,[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy] |
| Molecular Formula | C10H7NO5 |
| Molecular Weight | 221.16600 |
| Storage Condition | 2-8°C, dry, sealed |
| Application | 2-Phthalimidehydroxy-acetic acid is a PROTAC linker, belonging to the alkyl chain class. Can be used to synthesize PROTAC molecules. |
| PubChem ID | 15838290 |
| SMILES | O=C(O)CON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C10H7NO5/c12-8(13)5-16-11-9(14)6-3-1-2-4-7(6)10(11)15/h1-4H,5H2,(H,12,13) |
| InChI Key | STDDDVARCIVORC-UHFFFAOYSA-N |
| Transport Info | Product name: 2-Phthalimidehydroxy-acetic acid |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Alpha-cyano-alpha-phenyl butyric acid methyl ester | 24131-07-5 | 2A-1167120 |
| (4-(benzyloxy)-3,3-dimethyl but-1-yn-1-yl)trimethylsilane | 1294504-65-6 | 2A-1167124 |
| (3-chloro-3-methylbut-1-yn-1-yl) trimethylsilane | 18387-63-8 | 2A-1167126 |
| D-Thr-NH2 | 2A-1167133 | 2A-1167133 |
| 2-Bromo-5-methyl-4-nitrophenol | 14401-60-6 | 2A-1167134 |
| di-tert-butyl (3,3,3-trifluoropropane-1,2-diyl)dicarbamate | 259138-23-3 | 2A-1167138 |
| (1E,6E)-1,7-bis(4-(3-chloropropoxy)-3-methoxyphenyl)hepta-1,6-diene-3,5-dione | 2A-1167141 | 2A-1167141 |
| but-2-yn-1-amine hydrochloride | 50329-23-2 | 2A-1167144 |
| (4-chloro-3-nitrophenyl)(p-tolyl)methanone | 40306-24-9 | 2A-1167145 |
| potassium trifluoro(2-vinylphenyl)borate | 2A-1167147 | 2A-1167147 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA