![DINAPHTHO[1,2-B:1',2'-D]FURAN structure, CAS 194-63-8](/structures/180000/167103_2_194_63_8.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 194-63-8 |
| Catalog No. | 2A-1167086 |
| Chinese Name | 二萘并[2,1-b:1',2'-d]呋喃 |
| Synonyms | Dinaphtho[1,2-b:1',2'-d]furan; binaphthofuran |
| Molecular Formula | C20H12O |
| Molecular Weight | 268.309 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 486.9±14.0 °C at 760 mmHg |
| Melting Point | 159 °C |
| Appearance | Solid;White to Light yellow powder to crystal |
| Storage Condition | room temperature, dry |
| HTC | 2932999099 |
| PubChem ID | 479510 |
| SMILES | c1ccc2c(c1)ccc1oc3ccc4ccccc4c3c12 |
| InChI | InChI=1S/C20H12O/c1-3-7-15-13(5-1)9-11-17-19(15)20-16-8-4-2-6-14(16)10-12-18(20)21-17/h1-12H |
| InChI Key | QIMOZEUDRUTIBS-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-(4-broMo-phenyl)-dibenzofuran | 955959-84-9 | 2A-1167043 |
| N-([1,1'-biphenyl]-4-yl)dibenzo[b,d]furan-4-amine | 1318338-47-4 | 2A-1167044 |
| 4,4'-Dibromo-3,3'-bithiophene | 5556-13-8 | 2A-1167045 |
| 2-Nitropyridine | 15009-91-3 | 2A-1167078 |
| 2-broMobenzo[b]-naphtho[2,3-d]furan | 1627917-16-1 | 2A-1167084 |
| BENZO(B)NAPHTHO(1,2-D)THIOPHENE | 205-43-6 | 2A-1167089 |
| 5H-[1]benzothieno[3,2-c]carbazole(CBZS) | 1255308-97-4 | 2A-1167098 |
| 2-Methylbenzofuro[2,3-b]pyridin-8-yl trifluoromethanesulfonate | 1609373-98-9 | 2A-1167106 |
| 2-bromo-4-isopropylpyridine | 1086381-43-2 | 2A-1167109 |
| 2-(3'-BroMo-biphenyl-3-yl)-4,6-diphenyl-[1,3,5]triazine | 1606981-69-4 | 2A-1167110 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA