
CAS Number201138-91-2
Synonyms4,6-dibromo-dibenzofurane; Dibenzofuran,4,6-dibromo; 4,6-Dibromodibenzo[b,d]furan; 4,6-dibromo-dibenzofuran
Molecular FormulaC12H6Br2O
Molecular Weight325.983
Density1.9±0.1 g/cm3
Boiling Point396.0±22.0 °C at 760 mmHg
Melting Point149 °C
AppearanceSolid;White to Almost white powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 201138-91-2 |
| Catalog No. | 2A-1167042 |
| Chinese Name | 4,6-二溴二苯并呋喃 |
| Synonyms | 4,6-dibromo-dibenzofurane; Dibenzofuran,4,6-dibromo; 4,6-Dibromodibenzo[b,d]furan; 4,6-dibromo-dibenzofuran |
| Molecular Formula | C12H6Br2O |
| Molecular Weight | 325.983 |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 396.0±22.0 °C at 760 mmHg |
| Melting Point | 149 °C |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | room temperature, dry |
| PubChem ID | 6442215 |
| SMILES | Brc1cccc2c1oc1c(Br)cccc12 |
| InChI | InChI=1S/C12H6Br2O/c13-9-5-1-3-7-8-4-2-6-10(14)12(8)15-11(7)9/h1-6H |
| InChI Key | XSJLDNSNUICSQC-UHFFFAOYSA-N |
| Transport Info | Product name: 4,6-dibromodibenzofuran |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4,6-DibroMo-Dibenzothiophene | 669773-34-6 | 2A-1167034 |
| 4-(4-broMo-phenyl)-dibenzothiophene | 530402-77-8 | 2A-1167035 |
| 1-bromodibenzo[b,d]furan | 50548-45-3 | 2A-1167037 |
| 3-Bromodibenzofuran | 26608-06-0 | 2A-1167040 |
| 2,8-DIBROMODIBENZOFURAN | 10016-52-1 | 2A-1167041 |
| 4-(4-broMo-phenyl)-dibenzofuran | 955959-84-9 | 2A-1167043 |
| N-([1,1'-biphenyl]-4-yl)dibenzo[b,d]furan-4-amine | 1318338-47-4 | 2A-1167044 |
| 4,4'-Dibromo-3,3'-bithiophene | 5556-13-8 | 2A-1167045 |
| 2-Nitropyridine | 15009-91-3 | 2A-1167078 |
| 2-broMobenzo[b]-naphtho[2,3-d]furan | 1627917-16-1 | 2A-1167084 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA