
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51552-68-2 |
| Catalog No. | 2A-1167001 |
| Chinese Name | 7-喹啉甲酸甲酯 |
| Synonyms | Methyl 7-quinolinecarboxylate; 7-Quinolinecarboxylic acid, methyl ester; 7-Quinolinecarboxylic acid,methyl ester |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.195 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 315.1±15.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933499090 |
| PubChem ID | 38256725 |
| SMILES | COC(=O)c1ccc2cccnc2c1 |
| InChI | InChI=1S/C11H9NO2/c1-14-11(13)9-5-4-8-3-2-6-12-10(8)7-9/h2-7H,1H3 |
| InChI Key | ZTZCGCCFJZVRTO-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| iso-mulbel-rochromene | 2A-1166965 | 2A-1166965 |
| (5S)-5-phenyl morpholine -2-one hydrochloride | 491833-36-4 | 2A-1166995 |
| methyl 3-(benzyloxy)-1,4-dihydro-1-(2,2-dihydroxyethyl)-4-oxopyridine-2-carboxylate | 1206102-08-0 | 2A-1166996 |
| N-[2-[(4S)-4,5-Dihydro-4-(1-methylethyl)-2-oxazolyl]-6-methylphenyl]methanesulfonamide | 480444-15-3 | 2A-1166997 |
| 6-Isoquinolinecarboxylic Acid, 5,7-dichloro-1,2,3,4-tetrahydro,Hydrochloride | 1289646-93-0 | 2A-1166998 |
| 3-BROMO-5-METHYL-4-NITROPYRIDINE | 1379323-18-8 | 2A-1167007 |
| 2-(DIBENZOFURAN-4-yl)CARBAZOL | 1922121-95-6 | 2A-1167029 |
| 3-bromodibenzo[b,d]thiophene | 97511-04-1 | 2A-1167032 |
| 4-BROMODIBENZOTHIOPHENE | 97511-05-2 | 2A-1167033 |
| 4,6-DibroMo-Dibenzothiophene | 669773-34-6 | 2A-1167034 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA