
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 100665-41-6 |
| Catalog No. | 2A-1166961 |
| Chinese Name | 灵芝烯酸B |
| Synonyms | Ganoderenic acid B; (3β,5ξ,7β)-3,7-Dihydroxy-11,15,23-trioxolanosta-8,20(22)-dien-26-oic acid |
| Molecular Formula | C30H42O7 |
| Molecular Weight | 514.650 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 702.7±60.0 °C at 760 mmHg |
| Appearance | powder |
| Storage Condition | 2-8°C, sealed, dry |
| Application | Ganoderic acid B is a lanosterane-type triterpene isolated from Ganoderma lucidum. Ganoderic acid B has a strong reversal effect on ABCB1-mediated multidrug resistance of HepG2/ADM cells to doxorubici |
| PubChem ID | 85382487 |
| SMILES | CC(=CC(=O)CC(C)C(=O)O)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3O |
| InChI | InChI=1S/C30H42O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h10,16,18-19,21-22,32,34H,8-9,11-14H2,1-7H3,(H,36,37) |
| InChI Key | QECQJYAIIIIKJB-QQPHKSTLSA-N |
| Transport Info | Product name: Ganoderenic acid B |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-(9,9-dimethyl-9H-fluoren-4-yl)-9,9-dimethyl-9H-fluoren-2-amine | 1644054-07-8 | 2A-1166954 |
| Lucidone F | 2A-1166958 | 2A-1166958 |
| Lucidone A | 97653-92-4 | 2A-1166959 |
| Ganoderic acid I | 98665-20-4 | 2A-1166959 |
| Ganolactone B | 1028449-53-7 | 2A-1166960 |
| kuwanol A | 2A-1166963 | 2A-1166963 |
| Sangenone F | 2A-1166964 | 2A-1166964 |
| Sanggenol O | 2A-1166966 | 2A-1166966 |
| Sanggenol A | 174423-30-4 | 2A-1166967 |
| Kuwanon B | 62949-78-4 | 2A-1166968 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA