
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 942615-32-9 |
| Catalog No. | 2A-1166937 |
| Chinese Name | 4-溴-9,9-二甲基芴 |
| Synonyms | 4-Bromo-9,9-dimethyl-9H-fluorene; 4-bromo-9,9-dimethylfluorene |
| Molecular Formula | C15H13Br |
| Molecular Weight | 273.168 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 352.9±21.0 °C at 760 mmHg |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | room temperature |
| HTC | 2903999090 |
| PubChem ID | 140522826 |
| SMILES | CC1(C)c2ccccc2-c2c(Br)cccc21 |
| InChI | InChI=1S/C15H13Br/c1-15(2)11-7-4-3-6-10(11)14-12(15)8-5-9-13(14)16/h3-9H,1-2H3 |
| InChI Key | SXOUNESKHJIXNK-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 4-Bromo-9,9-dimethylfluorene Modification number: 6 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Bromo-9H-fluoren-9-one | 2041-19-2 | 2A-1166932 |
| 4-Bromo-9H-fluoren-9-one | 4269-17-4 | 2A-1166933 |
| 3,6-Dibromo-fluoren-9-one | 216312-73-1 | 2A-1166934 |
| 1-BroMo-9,9'-spirobi[9H-fluorene] | 1450933-18-2 | 2A-1166935 |
| 4-bromo-9,9'-Spirobi[9H-fluorene | 1161009-88-6 | 2A-1166936 |
| 2-bromo-9-methyl-9-phenyl-9H-fluorene | 1548450-68-5 | 2A-1166938 |
| 4-bromo-9-methyl-9-phenyl-9H-fluorene | 1548450-59-4 | 2A-1166939 |
| 4-BroMo-9,9-diphenyl-9H-fluorene | 713125-22-5 | 2A-1166940 |
| 9-(4-Bromophenyl)-9-phenylfluorene | 937082-81-0 | 2A-1166941 |
| 2-bromo-9,9-Dimethyl-9H-xanthene | 1565868-91-8 | 2A-1166942 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA