
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1075705-01-9 |
| Catalog No. | 2A-1166896 |
| Chinese Name | 4-氟-2-甲氧基-5-硝基苯胺 |
| Synonyms | 4-Fluoro-2-methoxy-5-nitroaniline |
| Molecular Formula | C7H7FN2O3 |
| Molecular Weight | 186.141 |
| Purity | 98 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 354.8±37.0 °C at 760 mmHg |
| Water Solubility | Slightly soluble (0.52 g/L) (25 ºC), calculated |
| Storage Condition | room temperature, dry |
| HTC | 2922299090 |
| PubChem ID | 140679529 |
| SMILES | COc1cc(F)c([N+](=O)[O-])cc1N |
| InChI | InChI=1S/C7H7FN2O3/c1-13-7-2-4(8)6(10(11)12)3-5(7)9/h2-3H,9H2,1H3 |
| InChI Key | FYSIGSQCZXQTIH-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N/A | 874288-11-6 | 2A-1166891 |
| N/A | 874288-27-4 | 2A-1166893 |
| N/A | 874288-21-8 | 2A-1166894 |
| N/A | 874288-33-2 | 2A-1166895 |
| 2-chloroaethoxyacetonitrile | 31250-08-5 | 2A-1166890 |
| (R,E)-ethyl 5-([1,1'-biphenyl]-4-yl)-4-((tert-butamino)-2-methylpent-2-enoat oxycarbonyl) | 149709-59-1 | 2A-1166898 |
| Tazobactam Diphenylmethyl Ester | 89789-07-1 | 2A-1166901 |
| 2-Bromopropionic acid | 1009-70-8 | 2A-4166902 |
| 3-N-isoamyl-N-ethylamino-6-methyl-7-Anilino fluoran | 70516-41-5 | 2A-4166903 |
| -Anilino-6-dibutylamino-3-methylfluoran | 89331-94-2 | 2A-4166904 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA