
CAS Number16308-92-2
Synonyms2,4-DIMETHYLBENZYL ALCOHOL; (2,4-dimethylphenyl)methyl alcohol; 2.4-Dimethyl-1-hydroxymethyl-benzol; EINECS 240-393-8; Benzyl alcohol,2,4-dimethyl; Benzenemethanol,2,4-dimethyl; MFCD00004624; 2,4-DIAMINO-6-FLUORO PYRIMIDINE; (2,4-Dimethyl-phenyl)-methanol; 2,4-Dimethyl-benzylalkohol
Molecular FormulaC9H12O
Molecular Weight136.19100
Purity96+%
Density1.032 g/cm3 (20°C)
Boiling Point120 °C13 mm Hg(lit.)
AppearanceTransparent colorless to slightly yellow
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 16308-92-2 |
| Catalog No. | 2A-0166494 |
| Chinese Name | 2,4-二甲基苄醇 |
| Synonyms | 2,4-DIMETHYLBENZYL ALCOHOL; (2,4-dimethylphenyl)methyl alcohol; 2.4-Dimethyl-1-hydroxymethyl-benzol; EINECS 240-393-8; Benzyl alcohol,2,4-dimethyl; Benzenemethanol,2,4-dimethyl; MFCD00004624; 2,4-DIAMINO-6-FLUORO PYRIMIDINE; (2,4-Dimethyl-phenyl)-methanol; 2,4-Dimethyl-benzylalkohol |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19100 |
| Purity | 96+ |
| Density | 1.032 g/cm3 (20°C) |
| Boiling Point | 120 °C13 mm Hg(lit.) |
| Appearance | Transparent colorless to slightly yellow |
| Storage Condition | Sealed at room temperature, protected from light, |
| HTC | 2906299090 |
| PubChem ID | 6038061 |
| SMILES | Cc1ccc(CO)c(C)c1 |
| InChI | InChI=1S/C9H12O/c1-7-3-4-9(6-10)8(2)5-7/h3-5,10H,6H2,1-2H3 |
| InChI Key | QUIMJTKRVOBTQN-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2906299090 other aromatic alcohols. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| (2,4-DINITROPHENYL)METHANOL | 4836-66-2 | 2A-0166482 |
| (2,4-DIMETHYLPYRIMIDIN-5-YL)METHANAMINE | 34684-92-9 | 2A-0166483 |
| (2,4-DICHLOROPHENYL)(4-METHYLPIPERIDIN-1-YL)METHANONE | 327069-50-1 | 2A-0166484 |
| (2,4-DICHLOROPYRIDIN-3-YL)(PHENYL)METHANONE | 134031-25-7 | 2A-0166488 |
| (2,4-DIMETHOXYPHENYL)MAGNESIUM BROMIDE | 138109-49-6 | 2A-0166493 |
| Chlorpyrifos Oxon-d10 | 1794779-85-3 | 2A-0166520 |
| 5-HYDROXYINDOLE-3-ACETIC ACID | 54-16-0 | 2A-1166607 |
| 2,4-DIAMINO PYRIMIDINE-3-OXIDE | 74638-76-9 | 2A-0201884 |
| Acetamide, 2-[[(2,4-dichlorophenyl)methyl]thio]-N-[4-[(2,3-dihydro-1,3-dioxo-1H-isoindol-5- yl)oxy]phenyl]- | 701253-05-6 | 2A-1166750 |
| 2,4-dichloropyrimidin-5-ol | 1395037-19-0 | 2A-1166881 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA