
CAS Number117-80-6
Synonyms2,3-Dichlor-1,4-naphthochinone; 2,3-dichloro-1,4-dihydronaphthalene-1,4-dione; 2,3-dichloronaphthalene-1,4-dione; EINECS 204-210-5; MFCD00001677; 2,3-Dichloro-1,4-naphthoquinone; 2,3-dichloro-1,4-naphthalenedione
Molecular FormulaC10H4Cl2O2
Molecular Weight227.04
Purity98%
Density1.5±0.1 g/cm3
Boiling Point304.0±42.0 °C at 760 mmHg
Melting Point194-197 °C (lit.)
AppearanceYellow crystalline powder
EINECS204-210-5
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 117-80-6 |
| Catalog No. | 2A-9001654 |
| Chinese Name | 2,3-二氯-1,4-萘醌 |
| Synonyms | 2,3-Dichlor-1,4-naphthochinone; 2,3-dichloro-1,4-dihydronaphthalene-1,4-dione; 2,3-dichloronaphthalene-1,4-dione; EINECS 204-210-5; MFCD00001677; 2,3-Dichloro-1,4-naphthoquinone; 2,3-dichloro-1,4-naphthalenedione |
| Molecular Formula | C10H4Cl2O2 |
| Molecular Weight | 227.04 |
| Purity | 98 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 304.0±42.0 °C at 760 mmHg |
| Melting Point | 194-197 °C (lit.) |
| Appearance | Yellow crystalline powder |
| Water Solubility | 0.008 g/L |
| Storage Condition | Store in a cool, ventilated warehouse. Keep away f |
| Packaging | III |
| EINECS | 204-210-5 |
| HTC | 29147090 |
| UN(IATA) | UN 2761/2811 |
| MDL Number | MFCD00001677 |
| SMILES | ClC1=C(Cl)C(=O)c2ccccc2C1=O |
| InChI | 1S/C10H4Cl2O2/c11-7-8(12)10(14)6-4-2-1-3-5(6)9(7)13/h1-4H |
| InChI Key | SVPKNMBRVBMTLB-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1073511 |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| Hazard Symbols | 6.1 |
| Risk Codes | R22;R36/38;R50/53 |
| Safety Description | S26;S60;S61 |
| MSDS | msds/1654_1_117_80_6.pdf |
| Tax Rebate | 0.0% |
| Supervision | S. Import and export pesticide registration certificate |
| Transport Info | Product name: Supervision conditions S. Import and export pesticide registration certificate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,3-Bis(1-methylethyl)amino-1-phenylpropyl-4-methylphenol | 124936-74-9 | 2A-9001643 |
| 2,3-Diaminophenol | 59649-56-8 | 2A-9001647 |
| 2,3-Diaminopropionic acid | 515-94-6 | 2A-9001648 |
| 2,3-Dibromo-1-propene | 513-31-5 | 2A-9001651 |
| 2,3-Dibromopropionyl chloride | 18791-02-1 | 2A-9001652 |
| 2,3-Dichloro-4-methyl-6-nitrobenzotrifluoride | 115571-67-0 | 2A-9001656 |
| 2,3-Dichloro-6-nitrobenzonitrile | 2112-22-3 | 2A-9001659 |
| 2',3'-Dichloroacetophenone | 56041-57-7 | 2A-9001660 |
| 2,3-Dichlorobenzenesulphonyl chloride | 82417-45-6 | 2A-9001663 |
| 2,3-Dichlorobenzonitrile | 6574-97-6 | 2A-9001664 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA