
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 71461-24-0 |
| Catalog No. | 2A-9000165 |
| Chinese Name | (+)-对溴四咪唑草酸盐 |
| Synonyms | MFCD00005537; EINECS 275-471-0 |
| Molecular Formula | C13H13BrN2O4S |
| Molecular Weight | 373.22200 |
| Purity | 98 |
| Density | 1.69g/cm3 |
| Boiling Point | 388.6ºC at 760 mmHg |
| Melting Point | 192ºC (dec.)(lit.) |
| Appearance | white solid |
| Storage Condition | This product should be sealed at 4 ℃ to dry and ke |
| HTC | 2934100090 |
| SMILES | Brc1ccc(C2CN3CCSC3=N2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C11H11BrN2S/c12-9-3-1-8(2-4-9)10-7-14-5-6-15-11(14)13-10/h1-4,10H,5-7H2/t10-/m0/s1 |
| InChI Key | ZULBIBHDIQCNIS-PPHPATTJSA-N |
| MSDS | msds/165_1_71461_24_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| (R)-(-)-alpha-[(3-Ethoxy-1-methyl-3-oxo-1-propenyl)amino]benzeneacetic acid potassium salt | 961-69-3 | 2A-9000160 |
| (R)-(-)-Epichlorohydrin | 51594-55-9 | 2A-0201597 |
| (R)-(-)-Ethylnipecotate-L-tartrate | 167392-57-6 | 2A-9000162 |
| (R)-(-)-Mandelic acid | 611-71-2 | 2A-9000163 |
| (R)-(-)-Propanediol | 4254-14-2 | 2A-9000164 |
| (R)-(+)-1,2,4-Butanetriol | 70005-88-8 | 2A-9000166 |
| (R)-(+)-1-Methylbenzylamine | 3886-69-9 | 2A-9000167 |
| (R)-(+)-2-(Benzyloxycarbonylamino)-3-phenyl-1-propanol | 58917-85-4 | 2A-9000168 |
| (R)-(+)-2,2-Dimethyl-1,3-dioxolane-4-carboxaldehyde | 15186-48-8 | 2A-9000169 |
| (R)-(+)-2-Hydroxy-1,2,2-triphenylethyl acetate | 95061-47-5 | 2A-9000170 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA