![SPIRO[3.3]HEPTANE-2,6-DICARBOXYLIC ACID structure, CAS 3057-91-8](/structures/180000/164186_1_3057_91_8.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3057-91-8 |
| Catalog No. | 2A-0164186 |
| Chinese Name | 螺[3.3]庚烷-2,6-二羧酸 |
| Synonyms | Fecht's acid; symm. Spiroheptan-dicarbonsaeure; Fecht acid |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 |
| Purity | 96+ |
| Density | 1.4g/cm3 |
| Boiling Point | 417.8ºC at 760mmHg |
| Melting Point | 230-235℃ |
| Appearance | white solid |
| Storage Condition | 2-8℃, protected from light, sealed |
| EINECS | 0 |
| HTC | 2917209090 |
| UN(IATA) | 0 |
| MDL Number | MFCD00610028 |
| SMILES | O=C(O)C1CC2(C1)CC(C(=O)O)C2 |
| InChI | InChI=1S/C9H12O4/c10-7(11)5-1-9(2-5)3-6(4-9)8(12)13/h5-6H,1-4H2,(H,10,11)(H,12,13) |
| InChI Key | JQZAKMJZYGPUFD-UHFFFAOYSA-N |
| MSDS | msds/164186_1_3057_91_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| QUINOLIN-7-YLBORONIC ACID | 629644-82-2 | 2A-0163984 |
| QUINUCLIDINE-3-CARBOXYLIC ACID | 75208-40-1 | 2A-0164027 |
| SPIRO[2.5]OCTAN-6-YLMETHANAMINE | 877201-35-9 | 2A-0164183 |
| SPIRO[2.5]OCTAN-6-YLMETHANOL | 849671-56-3 | 2A-0164184 |
| SPIRO[2.5]OCTANE-6-CARBOXYLIC ACID | 1086399-13-4 | 2A-0164185 |
| SPIRO[3.5]NONAN-7-YLMETHANAMINE | 877125-98-9 | 2A-0164187 |
| SPIRO[3.5]NONANE-7-CARBOXYLIC ACID | 1086399-15-6 | 2A-0164188 |
| SPIRO[4H-3,1-BENZOXAZINE-4,4'-PIPERIDIN]-2(1H)-ONE | 84060-09-3 | 2A-0164189 |
| SPIRO[5.5]UNDECAN-3-ONE | 1890-25-1 | 2A-0202101 |
| SPIRO[BENZO[D][1,3]OXAZINE-4,4'-PIPERIDIN]-2(1H)-ONE HYDROCHLORIDE | 85732-37-2 | 2A-0164192 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA