![N-PHENYL-[1,1'-BIPHENYL]-4-AMINE structure, CAS 32228-99-2](/structures/180000/162814_1_32228_99_2.png)
CAS Number32228-99-2
Synonyms(biphenyl-4-yl)phenylamine; N-Phenyl-[1,1'-biphenyl]-4-amine; 4-Anilinobiphenyl; N-Phenyl-4-biphenylamine; N-phenyl-bis(4-biphenyl)amine; N-(biphenyl-4-yl)-N-phenylamine; N-Phenylbiphenyl-4-amine; 4-phenyl-diphenylamine
Molecular FormulaC18H15N
Molecular Weight245.318
Purity96+%
Density1.1±0.1 g/cm3
Boiling Point411.2±24.0 °C at 760 mmHg
Melting Point113ºC
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 32228-99-2 |
| Catalog No. | 2A-0162814 |
| Chinese Name | N-苯基-4-联苯胺 |
| Synonyms | (biphenyl-4-yl)phenylamine; N-Phenyl-[1,1'-biphenyl]-4-amine; 4-Anilinobiphenyl; N-Phenyl-4-biphenylamine; N-phenyl-bis(4-biphenyl)amine; N-(biphenyl-4-yl)-N-phenylamine; N-Phenylbiphenyl-4-amine; 4-phenyl-diphenylamine |
| Molecular Formula | C18H15N |
| Molecular Weight | 245.318 |
| Purity | 96+ |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 411.2±24.0 °C at 760 mmHg |
| Melting Point | 113ºC |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| EINECS | 0 |
| HTC | 2921499090 |
| UN(IATA) | 0 |
| PubChem ID | 31519076 |
| SMILES | c1ccc(Nc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C18H15N/c1-3-7-15(8-4-1)16-11-13-18(14-12-16)19-17-9-5-2-6-10-17/h1-14,19H |
| InChI Key | YGNUPJXMDOFFDO-UHFFFAOYSA-N |
| MSDS | msds/162814_1_32228_99_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-METHYLTHIAZOL-2-AMINE HYDROCHLORIDE | 6142-07-0 | 2A-0162798 |
| N-P-TOLYL-MALONAMIC ACID | 95262-01-4 | 2A-0162807 |
| N-P-TOLYL-MALONAMIC ACID ETHYL ESTER | 72324-44-8 | 2A-0162808 |
| N-PHENETHYL-2-PHENYLACETAMIDE | 5460-60-6 | 2A-0162811 |
| N-PHENETHYLANILINE | 1739-00-0 | 2A-0162812 |
| N-PHENYL-N-(1-(PIPERIDIN-1-YL)PROPAN-2-YL)PROPIONAMIDE | 129-83-9 | 2A-0162821 |
| N-PHENYLMETHACRYLAMIDE | 1611-83-2 | 2A-0162830 |
| N-PHENYLPICOLINAMIDE | 10354-53-7 | 2A-0162835 |
| N-PHENYLPIPERIDIN-4-AMINE HYDROCHLORIDE | 1193388-65-6 | 2A-0162837 |
| N-PHENYLPIPERIDIN-4-ONE | 19125-34-9 | 2A-0162838 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA