
CAS Number101-02-0
SynonymsEFED; Triphenyl phosphite; jp360; EINECS 202-908-4; p36; TPO; westontpp; mellite310; MFCD00002080; Phosphorous acid, triphenyl ester; adkstabtpp; UNII-9P45GRD24X; advancetpp; Phosphorous Acid Triphenyl Ester
Molecular Formula(C6H5O)3P
Molecular Weight310.28
Purity97%
Density1.184 g/mL at 25 °C(lit.)
Boiling Point360 °C (lit.)
Melting Point22-24 °C (lit.)
AppearanceColorless to light yellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 101-02-0 |
| Catalog No. | 2A-9016045 |
| Chinese Name | 亚磷酸三苯酯 |
| Synonyms | EFED; Triphenyl phosphite; jp360; EINECS 202-908-4; p36; TPO; westontpp; mellite310; MFCD00002080; Phosphorous acid, triphenyl ester; adkstabtpp; UNII-9P45GRD24X; advancetpp; Phosphorous Acid Triphenyl Ester |
| Molecular Formula | (C6H5O)3P |
| Molecular Weight | 310.28 |
| Purity | 97 |
| Density | 1.184 g/mL at 25 °C(lit.) |
| Boiling Point | 360 °C (lit.) |
| Melting Point | 22-24 °C (lit.) |
| Appearance | Colorless to light yellow liquid |
| Water Solubility | insoluble |
| Storage Condition | Store in a cool, dry, well-ventilated warehouse. K |
| Packaging | III |
| HTC | 2920901900 |
| PubChem ID | 24900533 |
| MDL Number | MFCD00003032 |
| SMILES | O(P(Oc1ccccc1)Oc2ccccc2)c3ccccc3 |
| InChI | 1S/C18H15O3P/c1-4-10-16(11-5-1)19-22(20-17-12-6-2-7-13-17)21-18-14-8-3-9-15-18/h1-15H |
| InChI Key | HVLLSGMXQDNUAL-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1079456 |
| NACRES Code | NA.22 |
| UNSPSC | 12352108 |
| Hazard Symbols | 9 |
| MSDS | msds/16045_1_101_02_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Chemical name |
| Related Products in Plastic & Specialty Additives | ||
|---|---|---|
| Bis(triphenylphosphoranylidene)ammonium chloride | 21050-13-5 | 2A-9013845 |
| Dibutyl phthalate | 84-74-2 | 2A-9014253 |
| Methyl(triphenylphosphoranylidene)acetate | 2605-67-6 | 2A-9014969 |
| TRIPOTASSIUM PHOSPHATE | 7778-53-2 | 2A-9015423 |
| Triphenyl phosphate | 115-86-6 | 2A-9016044 |
| Triphenylantimony dichloride | 594-31-0 | 2A-9016046 |
| Triphenylbromogermane | 3005-32-1 | 2A-9016047 |
| Triphenyllead chloride | 1153-06-6 | 2A-9016048 |
| triphosphoric acid | 10380-08-2 | 2A-9016049 |
| Dopamine | 51-61-6 | 2A-9016613 |
| Browse all Plastic & Specialty Additives products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA