
CAS Number226396-32-3
SynonymsMFCD02684337; 2,3,4-Trifluorobenzeneboronic Acid; 4,5,6-Trifluorophenylboronic acid; (2,3,4-Trifluorophenyl)boronic acid; 2,3,4-Trifluorphenylboronic acid; 2,3,4-Trifluorophenylboronic acid
Molecular FormulaC6H4O2F3B1
Molecular Weight175.9
Purity98%
Density1.4±0.1 g/cm3
Boiling Point260.2±50.0 °C at 760 mmHg
Melting Point229-235 °C(lit.)
Appearancewhite solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 226396-32-3 |
| Catalog No. | 2A-9001604 |
| Chinese Name | 2,3,4-三氟苯硼酸 |
| Synonyms | MFCD02684337; 2,3,4-Trifluorobenzeneboronic Acid; 4,5,6-Trifluorophenylboronic acid; (2,3,4-Trifluorophenyl)boronic acid; 2,3,4-Trifluorphenylboronic acid; 2,3,4-Trifluorophenylboronic acid |
| Molecular Formula | C6H4O2F3B1 |
| Molecular Weight | 175.9 |
| Purity | 98 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 260.2±50.0 °C at 760 mmHg |
| Melting Point | 229-235 °C(lit.) |
| Appearance | white solid |
| Water Solubility | Water solubility: insoluble; soluble in: methanol |
| Storage Condition | Storage: Sealed, cool, ventilated and dry |
| HTC | 2931900090 |
| MDL Number | MFCD01863168 |
| SMILES | OB(O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C6H4BF3O2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,11-12H |
| InChI Key | CLGIPVVEERQWSQ-UHFFFAOYSA-N |
| MSDS | msds/1604_1_226396_32_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | AB (Inbound cargo customs clearance form) |
| Transport Info | Product name: Purity: 96.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2,2-Bis(trifluoromethyl)propanol | 2927-17-5 | 2A-9001542 |
| 2,2-Bis(trifluoromethyl)propionic acid | 45048-36-0 | 2A-9001543 |
| 2,2'-Diphenyldicarboxylic acid | 482-05-3 | 2A-9001572 |
| 2,3,4,5-Tetrafluorobenzaldehyde | 16583-06-5 | 2A-9001584 |
| 2,3,4-Trifluorobenzaldehyde | 161793-17-5 | 2A-9001597 |
| 2,3,4-Trihydroxybenzaldehyde | 2144-08-3 | 2A-9001605 |
| 2,3,4-Trimethoxybenzaldehyde | 2103-57-3 | 2A-9001606 |
| 2,3,5,6-Tetrafluorobenzaldehyde | 19842-76-3 | 2A-9001614 |
| 2,3,5-Trifluorobenzaldehyde | 126202-23-1 | 2A-9001627 |
| 2,3,5-Trifluorophenylboronic acid | 247564-73-4 | 2A-9001630 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA