
CAS Number176317-02-5
Synonyms2,3,4-Trifluorobromo; 1-Bromo-2,3,4-trifluorobenzene; p-bromotrifluorobenzene; MFCD00013248; 1-bromo-2,3,4-trilfluorobenzene; 4-bromotrifluorobenzene; 4-bromo-1,2,3-trifluorobenzene; 4-TrifluorobroMobenzene; 2,3,4-Trifluorobromobenzene; 2,3,4-Trifluoro-1-bromobenzene; FR BF CF DE
Molecular FormulaC6H2Br1F3
Molecular Weight210.98
Purity98%
Density1.8±0.1 g/cm3
Boiling Point152.6±35.0 °C at 760 mmHg
AppearanceTransparent light yellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 176317-02-5 |
| Catalog No. | 2A-9001600 |
| Chinese Name | 1-溴-2,3,4-三氟苯 |
| Synonyms | 2,3,4-Trifluorobromo; 1-Bromo-2,3,4-trifluorobenzene; p-bromotrifluorobenzene; MFCD00013248; 1-bromo-2,3,4-trilfluorobenzene; 4-bromotrifluorobenzene; 4-bromo-1,2,3-trifluorobenzene; 4-TrifluorobroMobenzene; 2,3,4-Trifluorobromobenzene; 2,3,4-Trifluoro-1-bromobenzene; FR BF CF DE |
| Molecular Formula | C6H2Br1F3 |
| Molecular Weight | 210.98 |
| Purity | 98 |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 152.6±35.0 °C at 760 mmHg |
| Appearance | Transparent light yellow liquid |
| Storage Condition | Storage: Sealed, cool, ventilated and dry |
| HTC | 2903999090 |
| UN(IATA) | UN1993 |
| MDL Number | MFCD00013248 |
| SMILES | Fc1ccc(Br)c(F)c1F |
| InChI | InChI=1S/C6H2BrF3/c7-3-1-2-4(8)6(10)5(3)9/h1-2H |
| InChI Key | MUUAQFJJUGVBGB-UHFFFAOYSA-N |
| Hazard Symbols | Xi |
| Risk Codes | R36/37/38 |
| Safety Description | S26;S37/39 |
| MSDS | msds/1600_1_176317_02_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 99.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,3,4-Trichloroacetophenone | 13608-87-2 | 2A-9001594 |
| 2,3,4-Trichloroanisol | 54135-80-7 | 2A-9001595 |
| 2,3,4-Trifluoroaniline | 3862-73-5 | 2A-9001596 |
| 2,3,4-Trifluorobenzoic acid | 61079-72-9 | 2A-9001598 |
| 2,3,4-Trifluorobenzonitrile | 143879-80-5 | 2A-9001599 |
| 2,3,4-Trifluorochlorobenzene | 36556-42-0 | 2A-9001601 |
| 2,3,4-Trifluoronitrobenzene | 771-69-7 | 2A-9001602 |
| 2,3,4-Trifluorophenol | 2822-41-5 | 2A-9001603 |
| 2,3,4-Trimethoxybenzoic acid | 573-11-5 | 2A-9001607 |
| 2,3,4-Trimethoxycinnamic acid | 33130-03-9 | 2A-9001608 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA