
CAS Number6654-36-0
Synonyms5-CarboMethoxy-1-pentanal; Einecs 229-678-8; Methyl adipaldehydate; 5-Formylpentanoic acid methyl ester; methyl 5-formylvalerate; METHYL 6-OXOHEXANOATE; 5-ForMylvaleric Acid Methyl Ester; 6-Oxohexanoic acid methyl ester; adipic acid hemialdehyde methyl ester; methyl 5-formylpentanoate; 5-methoxycarbonylpentanal; Hexanoic acid,6-oxo-,methyl ester
Molecular FormulaC7H12O3
Molecular Weight144.17
Purity96+%
Density1 g/mL at 25ºC(lit.)
Boiling Point189.4ºC at 760 mmHg
Appearanceliquid
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6654-36-0 |
| Catalog No. | 2A-0159695 |
| Chinese Name | 6-氧代己酸甲酯 |
| Synonyms | 5-CarboMethoxy-1-pentanal; Einecs 229-678-8; Methyl adipaldehydate; 5-Formylpentanoic acid methyl ester; methyl 5-formylvalerate; METHYL 6-OXOHEXANOATE; 5-ForMylvaleric Acid Methyl Ester; 6-Oxohexanoic acid methyl ester; adipic acid hemialdehyde methyl ester; methyl 5-formylpentanoate; 5-methoxycarbonylpentanal; Hexanoic acid,6-oxo-,methyl ester |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 |
| Purity | 96+ |
| Density | 1 g/mL at 25ºC(lit.) |
| Boiling Point | 189.4ºC at 760 mmHg |
| Appearance | liquid |
| Storage Condition | 2-8°C, inert gas |
| EINECS | 0 |
| HTC | 2918300090 |
| UN(IATA) | 0 |
| PubChem ID | 3151944 |
| SMILES | COC(=O)CCCCC=O |
| InChI | InChI=1S/C7H12O3/c1-10-7(9)5-3-2-4-6-8/h6H,2-5H2,1H3 |
| InChI Key | FDNFXHCDOASWAY-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| METHYL 6-HYDROXY-5-NITRONICOTINATE | 222970-61-8 | 2A-0159660 |
| METHYL 6-IODONICOTINATE | 173157-33-0 | 2A-0202102 |
| METHYL 6-METHOXYPICOLINATE | 26256-72-4 | 2A-0159675 |
| METHYL 6-MORPHOLINONICOTINATE | 132546-81-7 | 2A-0159686 |
| METHYL 6-NITROPICOLINATE | 26218-74-6 | 2A-0159688 |
| METHYL 7,7,7-TRIFLUORO-6-OXOHEPTANOATE | 141023-00-9 | 2A-0159701 |
| METHYL 8-HYDROXY-1-NAPHTHOATE | 5247-86-9 | 2A-0159768 |
| METHYL 8-OXO-8-(PHENYLAMINO)OCTANOATE | 162853-41-0 | 2A-0159774 |
| METHYL CARBONISOCYANATIDOATE | 5843-42-5 | 2A-0159802 |
| METHYL ISONICOTINIMIDATE | 35451-46-8 | 2A-0159843 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA