
CAS Number162100-83-6
Synonyms1H-Indole-5-carboxylic acid, 6-chloro-, methyl ester; Methyl 6-chloro-1H-indole-5-carboxylate; methyl 6-chloro-5-indolecarboxylate; 6-chloro-5-methoxycarbonyl indole; 6-Chloro-1H-indole-5-carboxylic acid methyl ester
Molecular FormulaC10H8ClNO2
Molecular Weight209.63
Purity96+%
Density1.4±0.1 g/cm3
Boiling Point365.6±22.0 °C at 760 mmHg
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 162100-83-6 |
| Catalog No. | 2A-0159618 |
| Chinese Name | 6-氯吲哚-5-羧酸甲酯 |
| Synonyms | 1H-Indole-5-carboxylic acid, 6-chloro-, methyl ester; Methyl 6-chloro-1H-indole-5-carboxylate; methyl 6-chloro-5-indolecarboxylate; 6-chloro-5-methoxycarbonyl indole; 6-Chloro-1H-indole-5-carboxylic acid methyl ester |
| Molecular Formula | C10H8ClNO2 |
| Molecular Weight | 209.63 |
| Purity | 96+ |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 365.6±22.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| EINECS | 0 |
| HTC | 2933990090 |
| UN(IATA) | 0 |
| PubChem ID | 15762710 |
| SMILES | COC(=O)c1cc2cc[nH]c2cc1Cl |
| InChI | InChI=1S/C10H8ClNO2/c1-14-10(13)7-4-6-2-3-12-9(6)5-8(7)11/h2-5,12H,1H3 |
| InChI Key | IGOUVTSYCXABHI-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| METHYL 6-BROMOQUINOLINE-2-CARBOXYLATE | 623583-88-0 | 2A-0159611 |
| METHYL 6-CHLORO-1H-BENZO[D]IMIDAZOLE-2-CARBOXYLATE | 113115-62-1 | 2A-0159613 |
| METHYL 6-CHLORO-1H-INDAZOLE-3-CARBOXYLATE | 717134-47-9 | 2A-1159614 |
| METHYL 6-CHLORO-1H-INDAZOLE-4-CARBOXYLATE | 885519-72-2 | 2A-0159615 |
| METHYL 6-CHLORO-1H-INDOLE-3-CARBOXYLATE | 921194-97-0 | 2A-0159617 |
| METHYL 6-CHLORO-1H-PYRROLO[3,2-B]PYRIDINE-3-CARBOXYLATE | 959245-12-6 | 2A-0159620 |
| METHYL 6-CHLOROPYRIMIDINE-4-CARBOXYLATE | 6627-22-1 | 2A-0159639 |
| METHYL 6-CHLOROQUINOLINE-3-CARBOXYLATE | 528862-02-4 | 2A-0159640 |
| METHYL 6-CYANO-1H-INDOLE-2-CARBOXYLATE | 104291-83-0 | 2A-0159641 |
| METHYL 6-CYANOPYRIDINE-2-CARBOXYLATE | 98436-83-0 | 2A-0159644 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA