
CAS Number8000-41-7
Synonymsaurora ka-475; terpineol n; (R)-(+)-α-Terpineol; MFCD00001557; 2-[(1R)-4-Methyl-3-cyclohexen-1-yl]-2-propanol; EINECS 232-268-1; a-terpineol; terpineol pfg; terpineol 350; terpineol,a
Molecular FormulaC10H18O
Molecular Weight154.25
Purity60.0-85.0 (GC)%
Density0.9±0.1 g/cm3
Boiling Point213-218 °C (lit.)
Melting Point18°C
Appearanceviscous liquid
EINECS232-268-1
Please Login or Create an Account to: See VlP prices and availability
US Stock: ship in 0-1 business day
Global Stock: ship in 5-7 days
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 8000-41-7 |
| Catalog No. | 2A-9015874 |
| Chinese Name | 松油醇 |
| Synonyms | aurora ka-475; terpineol n; (R)-(+)-α-Terpineol; MFCD00001557; 2-[(1R)-4-Methyl-3-cyclohexen-1-yl]-2-propanol; EINECS 232-268-1; a-terpineol; terpineol pfg; terpineol 350; terpineol,a |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 |
| Purity | 60.0-85.0 (GC) |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 213-218 °C (lit.) |
| Melting Point | 18°C |
| Appearance | viscous liquid |
| Water Solubility | slightly |
| Storage Condition | Store in a cool, ventilated and dry place. Heat, m |
| EINECS | 232-268-1 |
| HTC | 2906199090 |
| PubChem ID | 57653162 |
| MDL Number | MFCD00166983 |
| SMILES | CC(=C)C1CCC(C)(O)CC1.CC2=CCC(CC2)C(C)(C)O |
| InChI | 1S/2C10H18O/c1-8-4-6-9(7-5-8)10(2,3)11;1-8(2)9-4-6-10(3,11)7-5-9/h4,9,11H,5-7H2,1-3H3;9,11H,1,4-7H2,2-3H3 |
| InChI Key | MGABGZGUMNDCSN-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/15874_1_8000_41_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2906199090. cyclanic, cyclenic or cyclootherpenic alcohols. VAT:17.0%. Tax rebate rate:13.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Terbium(â ¢) bromide | 14456-47-4 | 2A-9015869 |
| TERBIUM(III) FLUORIDE | 13708-63-9 | 2A-9015870 |
| Terbium(â ¢) iodide | 13813-40-6 | 2A-9015871 |
| Terephthalic acid | 100-21-0 | 2A-9015872 |
| Terephthaloyl chloride | 100-20-9 | 2A-9015873 |
| tert-Amyl alcohol | 75-85-4 | 2A-9015875 |
| tert-Butanol | 75-65-0 | 2A-9015877 |
| tert-Butyl acetate | 540-88-5 | 2A-9015878 |
| tert-Butyl bromoacetate | 5292-43-3 | 2A-0202011 |
| tert-Butyl hydroperoxide | 75-91-2 | 2A-9015880 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA