
CAS Number74733-26-9
Synonyms4-carbomethoxy-2-chlorobenzaldehyde; 3-chloro-4-formylbenzoic acid methyl ester; Methyl 3-chloro-4-formylbenzoate; Benzoic acid, 3-chloro-4-formyl-, methyl ester
Molecular FormulaC9H7ClO3
Molecular Weight198.61
Purity96+%
Density1.3±0.1 g/cm3
Boiling Point315.8±27.0 °C at 760 mmHg
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 74733-26-9 |
| Catalog No. | 2A-0158313 |
| Chinese Name | 3-氯-4-甲酰基苯甲酸甲酯 |
| Synonyms | 4-carbomethoxy-2-chlorobenzaldehyde; 3-chloro-4-formylbenzoic acid methyl ester; Methyl 3-chloro-4-formylbenzoate; Benzoic acid, 3-chloro-4-formyl-, methyl ester |
| Molecular Formula | C9H7ClO3 |
| Molecular Weight | 198.61 |
| Purity | 96+ |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 315.8±27.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, inert gas atmosphere |
| EINECS | 0 |
| HTC | 2918300090 |
| UN(IATA) | 0 |
| PubChem ID | 55014049 |
| InChI | InChI=1S/C9H7ClO3/c1-13-9(12)6-2-3-7(5-11)8(10)4-6/h2-5H,1H3 |
| InChI Key | HTBWDEJOUJMERN-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| METHYL 3-BROMO-5-CYANOBENZOATE | 453566-15-9 | 2A-0158283 |
| METHYL 3-BROMO-5-HYDROXYBENZOATE | 192810-12-1 | 2A-0158284 |
| METHYL 3-BROMO-5-METHYLPICOLINATE | 1228880-68-9 | 2A-0158288 |
| METHYL 3-BROMO-6-HYDROXYPICOLINATE | 1214345-95-5 | 2A-0158291 |
| METHYL 3-CHLORO-4-(PIPERAZIN-1-YL)BENZOATE | 234082-16-7 | 2A-0158311 |
| METHYL 3-CHLORO-4-HYDROXYPHENYLACETATE | 57017-95-5 | 2A-0158315 |
| METHYL 3-CHLORO-4-IODOBENZOATE | 874569-39-8 | 2A-0158316 |
| METHYL 3-CHLORO-4-MORPHOLINOBENZOATE | 1314406-49-9 | 2A-0158318 |
| METHYL 3-CHLORO-5-IODOBENZOATE | 289039-85-6 | 2A-0158320 |
| METHYL 3-CHLORO-5-NITROBENZOATE | 36138-28-0 | 2A-0158321 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA