
CAS Number2699-79-8
SynonymsEINECS 220-281-5; sulphonyl fluoride; Sulphuryl difluoride; disulfonyl fluoride; Sulphuryl fluoride; Sulfur difluoride dioxide; Sulfonyl fluoride; Sulfuric oxyfluoride; Caswell No. 816A; sulfuryl fluoride; sulfonyl difluoride; MFCD00153272; Vikane; Vikane fumigant
Molecular FormulaF2O2S
Molecular Weight314.29
Purity≥98%
Density1.687g/cm3
Boiling Point-55,2°C
Melting Point146-149 °C
Appearancepowder or crystals
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2699-79-8 |
| Catalog No. | 2A-9015829 |
| Chinese Name | 硫酰氟 |
| Synonyms | EINECS 220-281-5; sulphonyl fluoride; Sulphuryl difluoride; disulfonyl fluoride; Sulphuryl fluoride; Sulfur difluoride dioxide; Sulfonyl fluoride; Sulfuric oxyfluoride; Caswell No. 816A; sulfuryl fluoride; sulfonyl difluoride; MFCD00153272; Vikane; Vikane fumigant |
| Molecular Formula | F2O2S |
| Molecular Weight | 314.29 |
| Purity | ≥98 |
| Density | 1.687g/cm3 |
| Boiling Point | -55,2°C |
| Melting Point | 146-149 °C |
| Appearance | powder or crystals |
| Storage Condition | The warehouse is ventilated and dried at low tempe |
| Packaging | Ⅱ |
| HTC | 2812901930 |
| MDL Number | MFCD31625434 |
| SMILES | F[S](=O)(=O)N([S](=O)(=O)F)c1ccc(cc1)NC(=O)C |
| InChI | InChI=1S/F2O2S/c1-5(2,3)4 |
| InChI Key | SMMIWAIOWMUFCR-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352101 |
| Hazard Symbols | 2.3 |
| MSDS | msds/15829_1_2699_79_8.pdf |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Sulfur trioxide | 7446-11-9 | 2A-9015823 |
| Sulfur(I) chloride | 10025-67-9 | 2A-9015824 |
| Sulfur(II) dichloride | 10545-99-0 | 2A-9015825 |
| Sulfurous acid | 7782-99-2 | 2A-9015827 |
| Sulfuryl chloride | 7791-25-5 | 2A-9015828 |
| Sulphur chloropentafluoride | 13780-57-9 | 2A-9015830 |
| Sulphur tetrafluoride | 7783-60-0 | 2A-9015831 |
| SWNT, 1-2nm | 2A-402826 | 2A-9015832 |
| SWNT-COOH | 2A-402827 | 2A-9015833 |
| SWNT-NH2 | 2A-402828 | 2A-9015834 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA