
CAS Number17094-21-2
SynonymsEINECS 241-161-9; Methyl 2-methylacetoacetate; Methyl 2-methyl-3-oxobutyrate; 2-methyl-3-oxo-butyric acid methyl ester; 2-methylacetoacetic acid methyl ester
Molecular FormulaC6H10O3
Molecular Weight130.14
Purity96+%
Density1.853g/cm3
Boiling Point537.1ºC at 760mmHg
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17094-21-2 |
| Catalog No. | 2A-0157829 |
| Chinese Name | 2-甲基-3-氧代丁酸甲酯 |
| Synonyms | EINECS 241-161-9; Methyl 2-methylacetoacetate; Methyl 2-methyl-3-oxobutyrate; 2-methyl-3-oxo-butyric acid methyl ester; 2-methylacetoacetic acid methyl ester |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 |
| Purity | 96+ |
| Density | 1.853g/cm3 |
| Boiling Point | 537.1ºC at 760mmHg |
| Storage Condition | room temperature |
| EINECS | 0 |
| HTC | 2918300090 |
| UN(IATA) | 0 |
| PubChem ID | 429822 |
| SMILES | COC(=O)C(C)C(C)=O |
| InChI | InChI=1S/C6H10O3/c1-4(5(2)7)6(8)9-3/h4H,1-3H3 |
| InChI Key | NDTWZHURUDSPQV-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| METHYL 2-ISOCYANATOACETATE | 30988-17-1 | 2A-0157794 |
| METHYL 2-METHOXY-1-NAPHTHOATE | 13343-92-5 | 2A-0157798 |
| METHYL 2-METHOXY-5-NITRONICOTINATE | 122433-50-5 | 2A-0157808 |
| METHYL 2-METHOXYNICOTINATE | 67367-26-4 | 2A-0157814 |
| METHYL 2-METHOXYPROPANOATE | 17639-76-8 | 2A-0157815 |
| METHYL 2-METHYL-5-NITRONICOTINATE | 936130-27-7 | 2A-0157835 |
| METHYL 2-METHYLBUT-3-YNOATE | 32804-66-3 | 2A-0157840 |
| METHYL 3,12-DIOXOOLEAN-9(11)-EN-28-OATE | 218600-50-1 | 2A-0157894 |
| METHYL 3,3,3-TRIFLUORO-2,2-DIMETHYLPROPANOATE | 1188911-72-9 | 2A-0157895 |
| METHYL 3,3,3-TRIFLUORO-2-((2,2,2-TRIFLUOROACETYL)IMINO)PROPANOATE | 114066-56-7 | 2A-0157896 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA