
CAS Number602-94-8
Synonyms2,3,4,5,6-Pentafluorobenzoic acid; Perfluorobenzoic acid; Pentafluorobenzoic acid; MFCD00002406; QVR BF CF DF EF FF; EINECS 210-026-6
Molecular FormulaC6F5CO2H
Molecular Weight212.07
Purity99%
Density1.7±0.1 g/cm3
Boiling Point220 °C (lit.)
Melting Point100-102 °C (lit.)
Appearancepowder
EINECS210-026-6
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 602-94-8 |
| Catalog No. | 2A-9001577 |
| Chinese Name | 五氟苯甲酸 |
| Synonyms | 2,3,4,5,6-Pentafluorobenzoic acid; Perfluorobenzoic acid; Pentafluorobenzoic acid; MFCD00002406; QVR BF CF DF EF FF; EINECS 210-026-6 |
| Molecular Formula | C6F5CO2H |
| Molecular Weight | 212.07 |
| Purity | 99 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 220 °C (lit.) |
| Melting Point | 100-102 °C (lit.) |
| Appearance | powder |
| Storage Condition | Sealed and stored in a cool, dry warehouse. |
| EINECS | 210-026-6 |
| HTC | 29163900 |
| UN(IATA) | UN 2811 |
| PubChem ID | 24898625 |
| MDL Number | MFCD00002406 |
| SMILES | OC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | 1S/C7HF5O2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h(H,13,14) |
| InChI Key | YZERDTREOUSUHF-UHFFFAOYSA-N |
| Beilstein/REAXYS | 2054395 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | T |
| Risk Codes | R25;R36/37/38 |
| Safety Description | S26;S36/37/39;S45 |
| MSDS | msds/1577_1_602_94_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,2-Dimethylphenylacetic acid | 826-55-1 | 2A-9001569 |
| 2,2'-Dinitrodibenzyl | 16968-19-7 | 2A-9001571 |
| 2,3,4,4'-Tetrahydroxybenzophenone | 31127-54-5 | 2A-9001574 |
| 2,3,4,5,6-Pentachlorobenzonitrile | 20925-85-3 | 2A-9001575 |
| 2,3,4,5,6-Pentafluoroaniline | 771-60-8 | 2A-9001576 |
| 2,3,4,5,6-Pentafluorobenzyl alcohol | 440-60-8 | 2A-9001578 |
| 2,3,4,5,6-Pentafluoronitrobenzene | 880-78-4 | 2A-9001579 |
| 3,4-(Methylenedioxy)thiophenol | 5274-08-8 | 2A-9001580 |
| 2,3,4,5,6-Pentafluorophenylacetonitrile | 653-30-5 | 2A-9001581 |
| 2,3,4,5-Di-O-isopropylidene-beta-D-fructopyranose | 20880-92-6 | 2A-9001582 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA