
CAS Number61837-46-5
Synonyms2-bromo-4-methylpentanoate; methyl 2-bromo-4,4,4-trichlorobutanoate; Methyl-2-brom-3,3,3-trichlorpropionat; Propanoic acid,2-bromo-3,3,3-trichloro-,methyl ester; 2-bromo-4-methylvaleric acid methyl ester; methyl-2-bromo-4-methylpentanoate; 2-bromo-4-methylpentanoic acid methyl ester
Molecular FormulaC7H13O2Br1
Molecular Weight209.08
Purity96+%
Boiling Point184.0±8.0°C at 760 mmHg
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 61837-46-5 |
| Catalog No. | 2A-0157612 |
| Chinese Name | 2-溴-4-甲基戊酸甲酯 |
| Synonyms | 2-bromo-4-methylpentanoate; methyl 2-bromo-4,4,4-trichlorobutanoate; Methyl-2-brom-3,3,3-trichlorpropionat; Propanoic acid,2-bromo-3,3,3-trichloro-,methyl ester; 2-bromo-4-methylvaleric acid methyl ester; methyl-2-bromo-4-methylpentanoate; 2-bromo-4-methylpentanoic acid methyl ester |
| Molecular Formula | C7H13O2Br1 |
| Molecular Weight | 209.08 |
| Purity | 96+ |
| Boiling Point | 184.0±8.0°C at 760 mmHg |
| Storage Condition | 2-8°C, store in inert gas |
| EINECS | 0 |
| HTC | 2915900090 |
| UN(IATA) | 0 |
| PubChem ID | 38343903 |
| MDL Number | MFCD00043896 |
| SMILES | COC(=O)C(Br)CC(C)C |
| InChI | InChI=1S/C7H13BrO2/c1-5(2)4-6(8)7(9)10-3/h5-6H,4H2,1-3H3 |
| InChI Key | SRPGFJDOALJGMR-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| METHYL 2-BROMO-3-PHENYLPROPANOATE | 3196-22-3 | 2A-0157602 |
| METHYL 2-BROMO-4,5-DIFLUOROBENZOATE | 878207-28-4 | 2A-0157604 |
| METHYL 2-BROMO-4,5-DIMETHOXYBENZOATE | 17667-32-2 | 2A-0157605 |
| METHYL 2-BROMO-4-CHLOROBENZOATE | 57381-62-1 | 2A-0157608 |
| METHYL 2-BROMO-4-METHOXYBENZOATE | 17100-65-1 | 2A-0157610 |
| METHYL 2-BROMO-4-PHENYLBUTANOATE | 16503-47-2 | 2A-0157616 |
| METHYL 2-BROMO-5-METHYLBENZOATE | 90971-88-3 | 2A-0157627 |
| METHYL 2-BROMOBUT-2-ENOATE | 17642-18-1 | 2A-0157644 |
| METHYL 2-CHLORO-2-(2-FLUOROPHENYL)ACETATE | 90055-51-9 | 2A-0157664 |
| METHYL 2-CHLORO-3,4-DIMETHOXYBENZOATE | 175136-01-3 | 2A-0157666 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA