
CAS Number515-74-2
SynonymsMFCD00064394; Einecs 208-208-5; anhydrous sulfanilic acid sodium salt; sulphanilic acid sodium salt; sodiumsulphanilate; 4-AMPYRONE HIGH GRADE; Sodium 4-aminobenzenesulfonate; Benzenesulfonic acid, 4-amino-, sodium salt (1:1); sulfanilic acid sodium salt; AMino benzene sulfonate; SODIUM ANILINESULFONATE; Sodium sulfanylate; 4-SULFOANILINE SODIUM SALT; p-Sulfoaniline sodium salt; 4-amino-benzenesulfonic acid sodium salt; 1-aminobenzene-4-sulphonic acid sodium salt
Molecular Formula4-(H2N)C6H4SO3Na·xH2O
Molecular Weight195.17 (anhydrous basis)
Purity97%
Density1.512 g/cm3
Melting Point288ºC
Appearancecrystals
EINECS208-208-5
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 515-74-2 |
| Catalog No. | 2A-9015632 |
| Chinese Name | 对氨基苯磺酸钠 |
| Synonyms | MFCD00064394; Einecs 208-208-5; anhydrous sulfanilic acid sodium salt; sulphanilic acid sodium salt; sodiumsulphanilate; 4-AMPYRONE HIGH GRADE; Sodium 4-aminobenzenesulfonate; Benzenesulfonic acid, 4-amino-, sodium salt (1:1); sulfanilic acid sodium salt; AMino benzene sulfonate; SODIUM ANILINESULFONATE; Sodium sulfanylate; 4-SULFOANILINE SODIUM SALT; p-Sulfoaniline sodium salt; 4-amino-benzenesulfonic acid sodium salt; 1-aminobenzene-4-sulphonic acid sodium salt |
| Molecular Formula | 4-(H2N)C6H4SO3Na·xH2O |
| Molecular Weight | 195.17 (anhydrous basis) |
| Purity | 97 |
| Density | 1.512 g/cm3 |
| Melting Point | 288ºC |
| Appearance | crystals |
| Storage Condition | 1. Store in a cool, dry and well-ventilated wareho |
| Application | Sodium Sulphanilate is a biochemical indicator of the acute phase response associated with inflammation. |
| EINECS | 208-208-5 |
| PubChem ID | 57648116 |
| MDL Number | MFCD00151043 |
| SMILES | O.[Na+].Nc1ccc(cc1)S([O-])(=O)=O |
| InChI | 1S/C6H7NO3S.Na.H2O/c7-5-1-3-6(4-2-5)11(8,9)10;;/h1-4H,7H2,(H,8,9,10);;1H2/q;+1;/p-1 |
| InChI Key | VDGKZGAQOPUDQL-UHFFFAOYSA-M |
| NACRES Code | NA.21 |
| UNSPSC | 12352100 |
| MSDS | msds/15632_1_515_74_2.pdf |
| Transport Info | Product name: Sodium 4-aminobenzene sulfonate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Silver-copper | 11144-43-7 | 2A-9015627 |
| Sodium | 7440-23-5 | 2A-9015628 |
| Sodium 2-bromoethanesulphonate | 4263-52-9 | 2A-9015629 |
| sodium 2-nitrophenolate | 824-39-5 | 2A-9015630 |
| Sodium 3,5,6-trichloropyridin-2-olate | 37439-34-2 | 2A-9015631 |
| Sodium acetate trihydrate | 6131-90-4 | 2A-9015634 |
| Sodium acid sulfate,monohydrate | 10034-88-5 | 2A-9015635 |
| Sodium allylsulfonate | 2495-39-8 | 2A-9015636 |
| Sodium aluminate | 1302-42-7 | 2A-9015637 |
| Sodium aluminum fluoride | 1302-84-7 | 2A-9015638 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA