
CAS Number16357-44-1
Synonyms3-Amino-4-methoxy-benzoesaeure-aethylester; 3-amino-4-methoxy-benzoic acid ethyl ester; 3-Amino-anissaeure-aethylester; 3-Amino-4-ethylamino-benzoic acid ethyl ester; Ethyl-3-amino-4-methoxybenzoat; ethyl 3-amino-4-ethylaminobenzoate
Molecular FormulaC10H13NO3
Molecular Weight195.21500
Purity96+%
Density1.148 g/cm3
Boiling Point337.981ºC at 760 mmHg
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 16357-44-1 |
| Catalog No. | 2A-0154112 |
| Chinese Name | 3-氨基-4-甲氧基苯甲酸乙酯 |
| Synonyms | 3-Amino-4-methoxy-benzoesaeure-aethylester; 3-amino-4-methoxy-benzoic acid ethyl ester; 3-Amino-anissaeure-aethylester; 3-Amino-4-ethylamino-benzoic acid ethyl ester; Ethyl-3-amino-4-methoxybenzoat; ethyl 3-amino-4-ethylaminobenzoate |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.21500 |
| Purity | 96+ |
| Density | 1.148 g/cm3 |
| Boiling Point | 337.981ºC at 760 mmHg |
| Storage Condition | 2-8°C, protected from light, inert gas |
| EINECS | 0 |
| HTC | 2922509090 |
| UN(IATA) | 0 |
| PubChem ID | 38282735 |
| SMILES | CCOC(=O)c1ccc(OC)c(N)c1 |
| InChI | InChI=1S/C10H13NO3/c1-3-14-10(12)7-4-5-9(13-2)8(11)6-7/h4-6H,3,11H2,1-2H3 |
| InChI Key | FEWCDEPEMGXGFK-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| ETHYL 3-AMINO-4-(DIMETHYLAMINO)BENZOATE | 178469-07-3 | 2A-0154076 |
| ETHYL 3-AMINO-4-(ETHYLAMINO)BENZOATE | 202131-30-4 | 2A-0154080 |
| ETHYL 3-AMINO-4-(PIPERIDIN-1-YL)BENZOATE | 71254-74-5 | 2A-0154086 |
| ETHYL 3-AMINO-4-ETHOXYBENZOATE | 141238-15-5 | 2A-0154109 |
| ETHYL 3-AMINO-4-IODOBENZOATE | 1261569-51-0 | 2A-0154111 |
| ETHYL 3-AMINO-4-METHYL-5-(METHYLSULFONYL)BENZOATE | 52317-30-3 | 2A-0154114 |
| ETHYL 3-AMINO-6-CHLORO-5-CYANO-2-METHYLISONICOTINATE | 99421-19-9 | 2A-0154132 |
| ETHYL 3-AMINO-6-METHOXYPICOLINATE | 959990-31-9 | 2A-0154133 |
| ETHYL 3-BROMO-2,2-DIFLUOROPROPANOATE | 111773-24-1 | 2A-1154150 |
| ETHYL 3-BROMO-2-FLUOROBENZOATE | 334792-76-6 | 2A-0154152 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA