
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 60868-41-9 |
| Catalog No. | 2A-0153893 |
| Chinese Name | 2',4'-二氯苯甲酰基乙酸乙酯 |
| Synonyms | Benzenepropanoic acid, 2,4-dichloro-β-oxo-, ethyl ester; Ethyl 3-(2,4-dichlorophenyl)-3-oxopropanoate |
| Molecular Formula | C11H10Cl2O3 |
| Molecular Weight | 261.1 |
| Purity | 96+ |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 322.7±27.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| EINECS | 0 |
| HTC | 2918300090 |
| UN(IATA) | 0 |
| PubChem ID | 3185119 |
| SMILES | CCOC(=O)CC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H10Cl2O3/c1-2-16-11(15)6-10(14)8-4-3-7(12)5-9(8)13/h3-5H,2,6H2,1H3 |
| InChI Key | QJVFFNRCSJWXPE-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| ETHYL 2,4-DIOXO-1,2,3,4-TETRAHYDROPYRROLO[2,1-F][1,2,4]TRIAZINE-6-CARBOXYLATE | 1245648-09-2 | 2A-0153106 |
| ETHYL 2-(2,4,5-TRIBROMO-1H-IMIDAZOL-1-YL)ACETATE | 112995-48-9 | 2A-0153186 |
| ETHYL 2-(2,4-DICHLORO-6-FORMYLPHENOXY)ACETATE | 16861-40-8 | 2A-0153190 |
| ETHYL 2-(2,4-DICHLOROPHENYL)THIAZOLE-4-CARBOXYLATE | 1185155-89-8 | 2A-0153191 |
| ETHYL 2-(2,4-DIFLUOROPHENYL)-2,2-DIFLUOROACETATE | 1228957-05-8 | 2A-0153193 |
| ETHYL 3-(2,4-DIFLUOROPHENYL)-3-OXOPROPANOATE | 58101-23-8 | 2A-0153894 |
| ETHYL 3-(2,4-DIFLUOROPHENYL)ACRYLATE | 134672-68-7 | 2A-0153895 |
| ETHYL 3-OXO-3-(2,4,5-TRIFLUORO-3-METHYLPHENYL)PROPANOATE | 112822-88-5 | 2A-0154305 |
| ETHYL 4-(3-CHLOROPHENYL)-2,4-DIOXOBUTANOATE | 57961-48-5 | 2A-0154436 |
| ETHYL 4-(4-CHLOROPHENYL)-3-METHYL-2,4-DIOXOBUTANOATE | 169544-41-6 | 2A-0154458 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA